C15H12 — CID 173020438
tricyclo[7.6.0.02,6]pentadeca-1(9),2(6),3,7,10,12,14-heptaene (PubChem CID 173020438) has the molecular formula C15H12 and a molecular weight of 192.26 g/mol. Its IUPAC name is tricyclo[7.6.0.02,6]pentadeca-1(9),2(6),3,7,10,12,14-heptaene.
| Compound Name | tricyclo[7.6.0.02,6]pentadeca-1(9),2(6),3,7,10,12,14-heptaene |
|---|---|
| PubChem CID | 173020438 |
| Molecular Formula | C15H12 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | tricyclo[7.6.0.02,6]pentadeca-1(9),2(6),3,7,10,12,14-heptaene |
| SMILES | C1=CC=Cc2c(ccc3c2C=CC3)C=C1 |
| InChI | InChI=1S/C15H12/c1-2-4-8-14-12(6-3-1)10-11-13-7-5-9-15(13)14/h1-6,8-11H,7H2 |
| InChIKey | LGRHUFPWJWIPFB-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |