C13H16 — CID 173020561
4,6,7,8,9,9a-hexahydro-1H-cyclopenta[a]naphthalene (PubChem CID 173020561) has the molecular formula C13H16 and a molecular weight of 172.27 g/mol. Its IUPAC name is 4,6,7,8,9,9a-hexahydro-1H-cyclopenta[a]naphthalene.
| Compound Name | 4,6,7,8,9,9a-hexahydro-1H-cyclopenta[a]naphthalene |
|---|---|
| PubChem CID | 173020561 |
| Molecular Formula | C13H16 |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.13 |
| IUPAC Name | 4,6,7,8,9,9a-hexahydro-1H-cyclopenta[a]naphthalene |
| SMILES | C1=CC2=C(C1)C1CCCCC1=CC2 |
| InChI | InChI=1S/C13H16/c1-2-6-12-10(4-1)8-9-11-5-3-7-13(11)12/h3,5,8,12H,1-2,4,6-7,9H2 |
| InChIKey | RDZHKHMACZDNFW-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|