About sodium;3-carbamoyl-2,2-dimethylbut-3-ene-1-sulfonic acid;hydride
sodium;3-carbamoyl-2,2-dimethylbut-3-ene-1-sulfonic acid;hydride (PubChem CID 173022202) has the molecular formula C7H14NNaO4S
and a molecular weight of 231.25 g/mol. Its IUPAC name is sodium;3-carbamoyl-2,2-dimethylbut-3-ene-1-sulfonic acid;hydride.
Molecular Properties
| Compound Name | sodium;3-carbamoyl-2,2-dimethylbut-3-ene-1-sulfonic acid;hydride |
| PubChem CID | 173022202 |
| Molecular Formula | C7H14NNaO4S |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | sodium;3-carbamoyl-2,2-dimethylbut-3-ene-1-sulfonic acid;hydride |
| SMILES | C=C(C(N)=O)C(C)(C)CS(=O)(=O)O.[H-].[Na+] |
| InChI | InChI=1S/C7H13NO4S.Na.H/c1-5(6(8)9)7(2,3)4-13(10,11)12;;/h1,4H2,2-3H3,(H2,8,9)(H,10,11,12);;/q;+1;-1 |
| InChIKey | HVDXSRKOTSLPMD-UHFFFAOYSA-N |
| XLogP | -2.94 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | -2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium;3-carbamoyl-2,2-dimethylbut-3-ene-1-sulfonic acid;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;3-carbamoyl-2,2-dimethylbut-3-ene-1-sulfonic acid;hydride?
The IUPAC name of sodium;3-carbamoyl-2,2-dimethylbut-3-ene-1-sulfonic acid;hydride (CID 173022202) is sodium;3-carbamoyl-2,2-dimethylbut-3-ene-1-sulfonic acid;hydride.
What is the SMILES notation for sodium;3-carbamoyl-2,2-dimethylbut-3-ene-1-sulfonic acid;hydride?
The canonical SMILES for sodium;3-carbamoyl-2,2-dimethylbut-3-ene-1-sulfonic acid;hydride is C=C(C(N)=O)C(C)(C)CS(=O)(=O)O.[H-].[Na+].
What is the InChIKey of sodium;3-carbamoyl-2,2-dimethylbut-3-ene-1-sulfonic acid;hydride?
The InChIKey is HVDXSRKOTSLPMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO4S.Na.H/c1-5(6(8)9)7(2,3)4-13(10,11)12;;/h1,4H2,2-3H3,(H2,8,9)(H,10,11,12);;/q;+1;-1.
What are the key properties of sodium;3-carbamoyl-2,2-dimethylbut-3-ene-1-sulfonic acid;hydride?
sodium;3-carbamoyl-2,2-dimethylbut-3-ene-1-sulfonic acid;hydride has a molecular weight of 231.25 g/mol, XLogP of -2.94, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;3-carbamoyl-2,2-dimethylbut-3-ene-1-sulfonic acid;hydride is sourced from PubChem (CID 173022202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).