About sodium;hydride;3-hydroxy-2,5-dioxopyrrolidine-3-sulfonic acid
sodium;hydride;3-hydroxy-2,5-dioxopyrrolidine-3-sulfonic acid (PubChem CID 173022591) has the molecular formula C4H6NNaO6S
and a molecular weight of 219.15 g/mol. Its IUPAC name is sodium;hydride;3-hydroxy-2,5-dioxopyrrolidine-3-sulfonic acid.
Molecular Properties
| Compound Name | sodium;hydride;3-hydroxy-2,5-dioxopyrrolidine-3-sulfonic acid |
| PubChem CID | 173022591 |
| Molecular Formula | C4H6NNaO6S |
| Molecular Weight | 219.15 g/mol |
| Exact Mass | 218.98 |
| IUPAC Name | sodium;hydride;3-hydroxy-2,5-dioxopyrrolidine-3-sulfonic acid |
| SMILES | O=C1CC(O)(S(=O)(=O)O)C(=O)N1.[H-].[Na+] |
| InChI | InChI=1S/C4H5NO6S.Na.H/c6-2-1-4(8,3(7)5-2)12(9,10)11;;/h8H,1H2,(H,5,6,7)(H,9,10,11);;/q;+1;-1 |
| InChIKey | YYNALBFTWQUUHX-UHFFFAOYSA-N |
| XLogP | -5.27 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.15 |
| LogP ≤ 5 | -5.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;3-hydroxy-2,5-dioxopyrrolidine-3-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;3-hydroxy-2,5-dioxopyrrolidine-3-sulfonic acid?
The IUPAC name of sodium;hydride;3-hydroxy-2,5-dioxopyrrolidine-3-sulfonic acid (CID 173022591) is sodium;hydride;3-hydroxy-2,5-dioxopyrrolidine-3-sulfonic acid.
What is the SMILES notation for sodium;hydride;3-hydroxy-2,5-dioxopyrrolidine-3-sulfonic acid?
The canonical SMILES for sodium;hydride;3-hydroxy-2,5-dioxopyrrolidine-3-sulfonic acid is O=C1CC(O)(S(=O)(=O)O)C(=O)N1.[H-].[Na+].
What is the InChIKey of sodium;hydride;3-hydroxy-2,5-dioxopyrrolidine-3-sulfonic acid?
The InChIKey is YYNALBFTWQUUHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5NO6S.Na.H/c6-2-1-4(8,3(7)5-2)12(9,10)11;;/h8H,1H2,(H,5,6,7)(H,9,10,11);;/q;+1;-1.
What are the key properties of sodium;hydride;3-hydroxy-2,5-dioxopyrrolidine-3-sulfonic acid?
sodium;hydride;3-hydroxy-2,5-dioxopyrrolidine-3-sulfonic acid has a molecular weight of 219.15 g/mol, XLogP of -5.27, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;3-hydroxy-2,5-dioxopyrrolidine-3-sulfonic acid is sourced from PubChem (CID 173022591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).