About dichlorozirconium;3-methyl-1H-inden-1-ide
dichlorozirconium;3-methyl-1H-inden-1-ide (PubChem CID 173023652) has the molecular formula C10H9Cl2Zr-
and a molecular weight of 291.31 g/mol. Its IUPAC name is dichlorozirconium;3-methyl-1H-inden-1-ide.
Molecular Properties
| Compound Name | dichlorozirconium;3-methyl-1H-inden-1-ide |
| PubChem CID | 173023652 |
| Molecular Formula | C10H9Cl2Zr- |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 288.91 |
| IUPAC Name | dichlorozirconium;3-methyl-1H-inden-1-ide |
| SMILES | Cc1c[cH-]c2ccccc12.Cl[Zr]Cl |
| InChI | InChI=1S/C10H9.2ClH.Zr/c1-8-6-7-9-4-2-3-5-10(8)9;;;/h2-7H,1H3;2*1H;/q-1;;;+2/p-2 |
| InChIKey | TZPQICKRWJAITF-UHFFFAOYSA-L |
| XLogP | 4.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze dichlorozirconium;3-methyl-1H-inden-1-ide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichlorozirconium;3-methyl-1H-inden-1-ide?
The IUPAC name of dichlorozirconium;3-methyl-1H-inden-1-ide (CID 173023652) is dichlorozirconium;3-methyl-1H-inden-1-ide.
What is the SMILES notation for dichlorozirconium;3-methyl-1H-inden-1-ide?
The canonical SMILES for dichlorozirconium;3-methyl-1H-inden-1-ide is Cc1c[cH-]c2ccccc12.Cl[Zr]Cl.
What is the InChIKey of dichlorozirconium;3-methyl-1H-inden-1-ide?
The InChIKey is TZPQICKRWJAITF-UHFFFAOYSA-L. The full InChI is InChI=1S/C10H9.2ClH.Zr/c1-8-6-7-9-4-2-3-5-10(8)9;;;/h2-7H,1H3;2*1H;/q-1;;;+2/p-2.
What are the key properties of dichlorozirconium;3-methyl-1H-inden-1-ide?
dichlorozirconium;3-methyl-1H-inden-1-ide has a molecular weight of 291.31 g/mol, XLogP of 4.24, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dichlorozirconium;3-methyl-1H-inden-1-ide is sourced from PubChem (CID 173023652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).