About [carbamimidoyl-[(2,3-dihydroxyphenyl)methylideneamino]amino] 4-methylbenzenesulfonate
[carbamimidoyl-[(2,3-dihydroxyphenyl)methylideneamino]amino] 4-methylbenzenesulfonate (PubChem CID 173023775) has the molecular formula C15H16N4O5S
and a molecular weight of 364.38 g/mol. Its IUPAC name is [carbamimidoyl-[(2,3-dihydroxyphenyl)methylideneamino]amino] 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | [carbamimidoyl-[(2,3-dihydroxyphenyl)methylideneamino]amino] 4-methylbenzenesulfonate |
| PubChem CID | 173023775 |
| Molecular Formula | C15H16N4O5S |
| Molecular Weight | 364.38 g/mol |
| Exact Mass | 364.08 |
| IUPAC Name | [carbamimidoyl-[(2,3-dihydroxyphenyl)methylideneamino]amino] 4-methylbenzenesulfonate |
| SMILES | [H]/N=C(\N)N(N=Cc1cccc(O)c1O)OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C15H16N4O5S/c1-10-5-7-12(8-6-10)25(22,23)24-19(15(16)17)18-9-11-3-2-4-13(20)14(11)21/h2-9,20-21H,1H3,(H3,16,17) |
| InChIKey | ZCHNIHJPDMCNSW-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 149.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.38 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze [carbamimidoyl-[(2,3-dihydroxyphenyl)methylideneamino]amino] 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [carbamimidoyl-[(2,3-dihydroxyphenyl)methylideneamino]amino] 4-methylbenzenesulfonate?
The IUPAC name of [carbamimidoyl-[(2,3-dihydroxyphenyl)methylideneamino]amino] 4-methylbenzenesulfonate (CID 173023775) is [carbamimidoyl-[(2,3-dihydroxyphenyl)methylideneamino]amino] 4-methylbenzenesulfonate.
What is the SMILES notation for [carbamimidoyl-[(2,3-dihydroxyphenyl)methylideneamino]amino] 4-methylbenzenesulfonate?
The canonical SMILES for [carbamimidoyl-[(2,3-dihydroxyphenyl)methylideneamino]amino] 4-methylbenzenesulfonate is [H]/N=C(\N)N(N=Cc1cccc(O)c1O)OS(=O)(=O)c1ccc(C)cc1.
What is the InChIKey of [carbamimidoyl-[(2,3-dihydroxyphenyl)methylideneamino]amino] 4-methylbenzenesulfonate?
The InChIKey is ZCHNIHJPDMCNSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N4O5S/c1-10-5-7-12(8-6-10)25(22,23)24-19(15(16)17)18-9-11-3-2-4-13(20)14(11)21/h2-9,20-21H,1H3,(H3,16,17).
What are the key properties of [carbamimidoyl-[(2,3-dihydroxyphenyl)methylideneamino]amino] 4-methylbenzenesulfonate?
[carbamimidoyl-[(2,3-dihydroxyphenyl)methylideneamino]amino] 4-methylbenzenesulfonate has a molecular weight of 364.38 g/mol, XLogP of 1.26, 5 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [carbamimidoyl-[(2,3-dihydroxyphenyl)methylideneamino]amino] 4-methylbenzenesulfonate is sourced from PubChem (CID 173023775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).