About sodium;(4-chlorophenyl) 4-[(4,4-dimethyl-3-oxopentan-2-yl)oxycarbonylamino]butanoate;hydride
sodium;(4-chlorophenyl) 4-[(4,4-dimethyl-3-oxopentan-2-yl)oxycarbonylamino]butanoate;hydride (PubChem CID 173024139) has the molecular formula C18H25ClNNaO5
and a molecular weight of 393.84 g/mol. Its IUPAC name is sodium;(4-chlorophenyl) 4-[(4,4-dimethyl-3-oxopentan-2-yl)oxycarbonylamino]butanoate;hydride.
Molecular Properties
| Compound Name | sodium;(4-chlorophenyl) 4-[(4,4-dimethyl-3-oxopentan-2-yl)oxycarbonylamino]butanoate;hydride |
| PubChem CID | 173024139 |
| Molecular Formula | C18H25ClNNaO5 |
| Molecular Weight | 393.84 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | sodium;(4-chlorophenyl) 4-[(4,4-dimethyl-3-oxopentan-2-yl)oxycarbonylamino]butanoate;hydride |
| SMILES | CC(OC(=O)NCCCC(=O)Oc1ccc(Cl)cc1)C(=O)C(C)(C)C.[H-].[Na+] |
| InChI | InChI=1S/C18H24ClNO5.Na.H/c1-12(16(22)18(2,3)4)24-17(23)20-11-5-6-15(21)25-14-9-7-13(19)8-10-14;;/h7-10,12H,5-6,11H2,1-4H3,(H,20,23);;/q;+1;-1 |
| InChIKey | YHVZIURLNNHIDM-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.84 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze sodium;(4-chlorophenyl) 4-[(4,4-dimethyl-3-oxopentan-2-yl)oxycarbonylamino]butanoate;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;(4-chlorophenyl) 4-[(4,4-dimethyl-3-oxopentan-2-yl)oxycarbonylamino]butanoate;hydride?
The IUPAC name of sodium;(4-chlorophenyl) 4-[(4,4-dimethyl-3-oxopentan-2-yl)oxycarbonylamino]butanoate;hydride (CID 173024139) is sodium;(4-chlorophenyl) 4-[(4,4-dimethyl-3-oxopentan-2-yl)oxycarbonylamino]butanoate;hydride.
What is the SMILES notation for sodium;(4-chlorophenyl) 4-[(4,4-dimethyl-3-oxopentan-2-yl)oxycarbonylamino]butanoate;hydride?
The canonical SMILES for sodium;(4-chlorophenyl) 4-[(4,4-dimethyl-3-oxopentan-2-yl)oxycarbonylamino]butanoate;hydride is CC(OC(=O)NCCCC(=O)Oc1ccc(Cl)cc1)C(=O)C(C)(C)C.[H-].[Na+].
What is the InChIKey of sodium;(4-chlorophenyl) 4-[(4,4-dimethyl-3-oxopentan-2-yl)oxycarbonylamino]butanoate;hydride?
The InChIKey is YHVZIURLNNHIDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24ClNO5.Na.H/c1-12(16(22)18(2,3)4)24-17(23)20-11-5-6-15(21)25-14-9-7-13(19)8-10-14;;/h7-10,12H,5-6,11H2,1-4H3,(H,20,23);;/q;+1;-1.
What are the key properties of sodium;(4-chlorophenyl) 4-[(4,4-dimethyl-3-oxopentan-2-yl)oxycarbonylamino]butanoate;hydride?
sodium;(4-chlorophenyl) 4-[(4,4-dimethyl-3-oxopentan-2-yl)oxycarbonylamino]butanoate;hydride has a molecular weight of 393.84 g/mol, XLogP of 0.87, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;(4-chlorophenyl) 4-[(4,4-dimethyl-3-oxopentan-2-yl)oxycarbonylamino]butanoate;hydride is sourced from PubChem (CID 173024139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).