C10H17N3O3 — CID 173024701
(2R)-2-[(3R,7S)-3,7-diamino-2,8-dioxoazocan-1-yl]propanal (PubChem CID 173024701) has the molecular formula C10H17N3O3 and a molecular weight of 227.26 g/mol. Its IUPAC name is (2R)-2-[(3R,7S)-3,7-diamino-2,8-dioxoazocan-1-yl]propanal.
| Compound Name | (2R)-2-[(3R,7S)-3,7-diamino-2,8-dioxoazocan-1-yl]propanal |
|---|---|
| PubChem CID | 173024701 |
| Molecular Formula | C10H17N3O3 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | (2R)-2-[(3R,7S)-3,7-diamino-2,8-dioxoazocan-1-yl]propanal |
| SMILES | C[C@H](C=O)N1C(=O)[C@H](N)CCC[C@H](N)C1=O |
| InChI | InChI=1S/C10H17N3O3/c1-6(5-14)13-9(15)7(11)3-2-4-8(12)10(13)16/h5-8H,2-4,11-12H2,1H3/t6-,7-,8+/m1/s1 |
| InChIKey | GTQNSPZHUWUYNW-PRJMDXOYSA-N |
| XLogP | -1.23 |
| TPSA | 106.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|