About 2,4,6-trifluorobenzenethiol;pentahydrofluoride
2,4,6-trifluorobenzenethiol;pentahydrofluoride (PubChem CID 173024841) has the molecular formula C6H8F8S
and a molecular weight of 264.18 g/mol. Its IUPAC name is 2,4,6-trifluorobenzenethiol;pentahydrofluoride.
Molecular Properties
| Compound Name | 2,4,6-trifluorobenzenethiol;pentahydrofluoride |
| PubChem CID | 173024841 |
| Molecular Formula | C6H8F8S |
| Molecular Weight | 264.18 g/mol |
| Exact Mass | 264.02 |
| IUPAC Name | 2,4,6-trifluorobenzenethiol;pentahydrofluoride |
| SMILES | F.F.F.F.F.Fc1cc(F)c(S)c(F)c1 |
| InChI | InChI=1S/C6H3F3S.5FH/c7-3-1-4(8)6(10)5(9)2-3;;;;;/h1-2,10H;5*1H |
| InChIKey | NRIRPRQQBIDSNV-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.18 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2,4,6-trifluorobenzenethiol;pentahydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4,6-trifluorobenzenethiol;pentahydrofluoride?
The IUPAC name of 2,4,6-trifluorobenzenethiol;pentahydrofluoride (CID 173024841) is 2,4,6-trifluorobenzenethiol;pentahydrofluoride.
What is the SMILES notation for 2,4,6-trifluorobenzenethiol;pentahydrofluoride?
The canonical SMILES for 2,4,6-trifluorobenzenethiol;pentahydrofluoride is F.F.F.F.F.Fc1cc(F)c(S)c(F)c1.
What is the InChIKey of 2,4,6-trifluorobenzenethiol;pentahydrofluoride?
The InChIKey is NRIRPRQQBIDSNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3F3S.5FH/c7-3-1-4(8)6(10)5(9)2-3;;;;;/h1-2,10H;5*1H.
What are the key properties of 2,4,6-trifluorobenzenethiol;pentahydrofluoride?
2,4,6-trifluorobenzenethiol;pentahydrofluoride has a molecular weight of 264.18 g/mol, XLogP of 3.16, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4,6-trifluorobenzenethiol;pentahydrofluoride is sourced from PubChem (CID 173024841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).