C23H32N4O5 — CID 173025031
tert-butyl 8-(N'-hydroxycarbamimidoyl)-1-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-3,4-dihydro-1H-pyrazino[1,2-a]indole-2-carboxylate (PubChem CID 173025031) has the molecular formula C23H32N4O5 and a molecular weight of 444.53 g/mol. Its IUPAC name is tert-butyl 8-(N'-hydroxycarbamimidoyl)-1-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-3,4-dihydro-1H-pyrazino[1,2-a]indole-2-carboxylate.
| Compound Name | tert-butyl 8-(N'-hydroxycarbamimidoyl)-1-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-3,4-dihydro-1H-pyrazino[1,2-a]indole-2-carboxylate |
|---|---|
| PubChem CID | 173025031 |
| Molecular Formula | C23H32N4O5 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.24 |
| IUPAC Name | tert-butyl 8-(N'-hydroxycarbamimidoyl)-1-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-3,4-dihydro-1H-pyrazino[1,2-a]indole-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)CC1c2cc3cc(C(N)=NO)ccc3n2CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H32N4O5/c1-22(2,3)31-19(28)13-18-17-12-15-11-14(20(24)25-30)7-8-16(15)26(17)9-10-27(18)21(29)32-23(4,5)6/h7-8,11-12,18,30H,9-10,13H2,1-6H3,(H2,24,25) |
| InChIKey | KRNKRNPUMHQISR-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 119.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|