C9H21NO5S — CID 173026045
1-hydroxy-2,2,6,6-tetramethylpiperidine;sulfuric acid (PubChem CID 173026045) has the molecular formula C9H21NO5S and a molecular weight of 255.34 g/mol. Its IUPAC name is 1-hydroxy-2,2,6,6-tetramethylpiperidine;sulfuric acid.
| Compound Name | 1-hydroxy-2,2,6,6-tetramethylpiperidine;sulfuric acid |
|---|---|
| PubChem CID | 173026045 |
| Molecular Formula | C9H21NO5S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 1-hydroxy-2,2,6,6-tetramethylpiperidine;sulfuric acid |
| SMILES | CC1(C)CCCC(C)(C)N1O.O=S(=O)(O)O |
| InChI | InChI=1S/C9H19NO.H2O4S/c1-8(2)6-5-7-9(3,4)10(8)11;1-5(2,3)4/h11H,5-7H2,1-4H3;(H2,1,2,3,4) |
| InChIKey | SAZGBCPZJFYNOX-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|