About sodium;hydride;4-piperazin-1-ylquinolin-7-ol
sodium;hydride;4-piperazin-1-ylquinolin-7-ol (PubChem CID 173028070) has the molecular formula C13H16N3NaO
and a molecular weight of 253.28 g/mol. Its IUPAC name is sodium;hydride;4-piperazin-1-ylquinolin-7-ol.
Molecular Properties
| Compound Name | sodium;hydride;4-piperazin-1-ylquinolin-7-ol |
| PubChem CID | 173028070 |
| Molecular Formula | C13H16N3NaO |
| Molecular Weight | 253.28 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | sodium;hydride;4-piperazin-1-ylquinolin-7-ol |
| SMILES | Oc1ccc2c(N3CCNCC3)ccnc2c1.[H-].[Na+] |
| InChI | InChI=1S/C13H15N3O.Na.H/c17-10-1-2-11-12(9-10)15-4-3-13(11)16-7-5-14-6-8-16;;/h1-4,9,14,17H,5-8H2;;/q;+1;-1 |
| InChIKey | UUZCGGBCCATSJL-UHFFFAOYSA-N |
| XLogP | -1.53 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.28 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze sodium;hydride;4-piperazin-1-ylquinolin-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;4-piperazin-1-ylquinolin-7-ol?
The IUPAC name of sodium;hydride;4-piperazin-1-ylquinolin-7-ol (CID 173028070) is sodium;hydride;4-piperazin-1-ylquinolin-7-ol.
What is the SMILES notation for sodium;hydride;4-piperazin-1-ylquinolin-7-ol?
The canonical SMILES for sodium;hydride;4-piperazin-1-ylquinolin-7-ol is Oc1ccc2c(N3CCNCC3)ccnc2c1.[H-].[Na+].
What is the InChIKey of sodium;hydride;4-piperazin-1-ylquinolin-7-ol?
The InChIKey is UUZCGGBCCATSJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N3O.Na.H/c17-10-1-2-11-12(9-10)15-4-3-13(11)16-7-5-14-6-8-16;;/h1-4,9,14,17H,5-8H2;;/q;+1;-1.
What are the key properties of sodium;hydride;4-piperazin-1-ylquinolin-7-ol?
sodium;hydride;4-piperazin-1-ylquinolin-7-ol has a molecular weight of 253.28 g/mol, XLogP of -1.53, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;4-piperazin-1-ylquinolin-7-ol is sourced from PubChem (CID 173028070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).