About 1,1-dimethylpiperidin-1-ium;2-hydroxy-2-oxoacetate
1,1-dimethylpiperidin-1-ium;2-hydroxy-2-oxoacetate (PubChem CID 173028451) has the molecular formula C9H17NO4
and a molecular weight of 203.24 g/mol. Its IUPAC name is 1,1-dimethylpiperidin-1-ium;2-hydroxy-2-oxoacetate.
Molecular Properties
| Compound Name | 1,1-dimethylpiperidin-1-ium;2-hydroxy-2-oxoacetate |
| PubChem CID | 173028451 |
| Molecular Formula | C9H17NO4 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | 1,1-dimethylpiperidin-1-ium;2-hydroxy-2-oxoacetate |
| SMILES | C[N+]1(C)CCCCC1.O=C([O-])C(=O)O |
| InChI | InChI=1S/C7H16N.C2H2O4/c1-8(2)6-4-3-5-7-8;3-1(4)2(5)6/h3-7H2,1-2H3;(H,3,4)(H,5,6)/q+1;/p-1 |
| InChIKey | YJWLNUWHPTZRBO-UHFFFAOYSA-M |
| XLogP | -0.93 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dimethylpiperidin-1-ium;2-hydroxy-2-oxoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dimethylpiperidin-1-ium;2-hydroxy-2-oxoacetate?
The IUPAC name of 1,1-dimethylpiperidin-1-ium;2-hydroxy-2-oxoacetate (CID 173028451) is 1,1-dimethylpiperidin-1-ium;2-hydroxy-2-oxoacetate.
What is the SMILES notation for 1,1-dimethylpiperidin-1-ium;2-hydroxy-2-oxoacetate?
The canonical SMILES for 1,1-dimethylpiperidin-1-ium;2-hydroxy-2-oxoacetate is C[N+]1(C)CCCCC1.O=C([O-])C(=O)O.
What is the InChIKey of 1,1-dimethylpiperidin-1-ium;2-hydroxy-2-oxoacetate?
The InChIKey is YJWLNUWHPTZRBO-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H16N.C2H2O4/c1-8(2)6-4-3-5-7-8;3-1(4)2(5)6/h3-7H2,1-2H3;(H,3,4)(H,5,6)/q+1;/p-1.
What are the key properties of 1,1-dimethylpiperidin-1-ium;2-hydroxy-2-oxoacetate?
1,1-dimethylpiperidin-1-ium;2-hydroxy-2-oxoacetate has a molecular weight of 203.24 g/mol, XLogP of -0.93, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dimethylpiperidin-1-ium;2-hydroxy-2-oxoacetate is sourced from PubChem (CID 173028451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).