About boric acid;scandium
boric acid;scandium (PubChem CID 173028800) has the molecular formula H3BO3Sc
and a molecular weight of 106.79 g/mol. Its IUPAC name is boric acid;scandium.
Molecular Properties
| Compound Name | boric acid;scandium |
| PubChem CID | 173028800 |
| Molecular Formula | H3BO3Sc |
| Molecular Weight | 106.79 g/mol |
| Exact Mass | 106.97 |
| IUPAC Name | boric acid;scandium |
| SMILES | OB(O)O.[Sc] |
| InChI | InChI=1S/BH3O3.Sc/c2-1(3)4;/h2-4H; |
| InChIKey | MZNMMWTZRCSIPY-UHFFFAOYSA-N |
| XLogP | -2.05 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 106.79 |
| LogP ≤ 5 | -2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze boric acid;scandium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of boric acid;scandium?
The IUPAC name of boric acid;scandium (CID 173028800) is boric acid;scandium.
What is the SMILES notation for boric acid;scandium?
The canonical SMILES for boric acid;scandium is OB(O)O.[Sc].
What is the InChIKey of boric acid;scandium?
The InChIKey is MZNMMWTZRCSIPY-UHFFFAOYSA-N. The full InChI is InChI=1S/BH3O3.Sc/c2-1(3)4;/h2-4H;.
What are the key properties of boric acid;scandium?
boric acid;scandium has a molecular weight of 106.79 g/mol, XLogP of -2.05, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for boric acid;scandium is sourced from PubChem (CID 173028800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).