C25H24N6O3S2 — CID 173031094
ethyl N-[1-[4-(methoxyiminomethyl)phenyl]-3-(6-methyl-3-pyridinyl)-4,5-dihydropyrazolo[4,5-g][1,3]benzothiazol-7-yl]-N-sulfanylcarbamate (PubChem CID 173031094) has the molecular formula C25H24N6O3S2 and a molecular weight of 520.64 g/mol. Its IUPAC name is ethyl N-[1-[4-(methoxyiminomethyl)phenyl]-3-(6-methyl-3-pyridinyl)-4,5-dihydropyrazolo[4,5-g][1,3]benzothiazol-7-yl]-N-sulfanylcarbamate.
| Compound Name | ethyl N-[1-[4-(methoxyiminomethyl)phenyl]-3-(6-methyl-3-pyridinyl)-4,5-dihydropyrazolo[4,5-g][1,3]benzothiazol-7-yl]-N-sulfanylcarbamate |
|---|---|
| PubChem CID | 173031094 |
| Molecular Formula | C25H24N6O3S2 |
| Molecular Weight | 520.64 g/mol |
| Exact Mass | 520.14 |
| IUPAC Name | ethyl N-[1-[4-(methoxyiminomethyl)phenyl]-3-(6-methyl-3-pyridinyl)-4,5-dihydropyrazolo[4,5-g][1,3]benzothiazol-7-yl]-N-sulfanylcarbamate |
| SMILES | CCOC(=O)N(S)c1nc2c(s1)-c1c(c(-c3ccc(C)nc3)nn1-c1ccc(C=NOC)cc1)CC2 |
| InChI | InChI=1S/C25H24N6O3S2/c1-4-34-25(32)31(35)24-28-20-12-11-19-21(17-8-5-15(2)26-14-17)29-30(22(19)23(20)36-24)18-9-6-16(7-10-18)13-27-33-3/h5-10,13-14,35H,4,11-12H2,1-3H3 |
| InChIKey | DAOLDCJYTFUZIY-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 94.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.64 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|