C8H13N2NaO2S — CID 173031111
sodium;5,5-diethyl-2-sulfanylidene-1,3-diazinane-4,6-dione;hydride (PubChem CID 173031111) has the molecular formula C8H13N2NaO2S and a molecular weight of 224.26 g/mol. Its IUPAC name is sodium;5,5-diethyl-2-sulfanylidene-1,3-diazinane-4,6-dione;hydride.
| Compound Name | sodium;5,5-diethyl-2-sulfanylidene-1,3-diazinane-4,6-dione;hydride |
|---|---|
| PubChem CID | 173031111 |
| Molecular Formula | C8H13N2NaO2S |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | sodium;5,5-diethyl-2-sulfanylidene-1,3-diazinane-4,6-dione;hydride |
| SMILES | CCC1(CC)C(=O)NC(=S)NC1=O.[H-].[Na+] |
| InChI | InChI=1S/C8H12N2O2S.Na.H/c1-3-8(4-2)5(11)9-7(13)10-6(8)12;;/h3-4H2,1-2H3,(H2,9,10,11,12,13);;/q;+1;-1 |
| InChIKey | VIIGMXYLIBGLAP-UHFFFAOYSA-N |
| XLogP | -2.56 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | -2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|