About [dimethoxy(trimethylsilylmethyl)silyl] 2-methylhexa-2,5-dieneperoxoate
[dimethoxy(trimethylsilylmethyl)silyl] 2-methylhexa-2,5-dieneperoxoate (PubChem CID 173032273) has the molecular formula C13H26O5Si2
and a molecular weight of 318.52 g/mol. Its IUPAC name is [dimethoxy(trimethylsilylmethyl)silyl] 2-methylhexa-2,5-dieneperoxoate.
Molecular Properties
| Compound Name | [dimethoxy(trimethylsilylmethyl)silyl] 2-methylhexa-2,5-dieneperoxoate |
| PubChem CID | 173032273 |
| Molecular Formula | C13H26O5Si2 |
| Molecular Weight | 318.52 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | [dimethoxy(trimethylsilylmethyl)silyl] 2-methylhexa-2,5-dieneperoxoate |
| SMILES | C=CCC=C(C)C(=O)OO[Si](C[Si](C)(C)C)(OC)OC |
| InChI | InChI=1S/C13H26O5Si2/c1-8-9-10-12(2)13(14)17-18-20(15-3,16-4)11-19(5,6)7/h8,10H,1,9,11H2,2-7H3 |
| InChIKey | WJVZQRGDZBLBPA-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.52 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze [dimethoxy(trimethylsilylmethyl)silyl] 2-methylhexa-2,5-dieneperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [dimethoxy(trimethylsilylmethyl)silyl] 2-methylhexa-2,5-dieneperoxoate?
The IUPAC name of [dimethoxy(trimethylsilylmethyl)silyl] 2-methylhexa-2,5-dieneperoxoate (CID 173032273) is [dimethoxy(trimethylsilylmethyl)silyl] 2-methylhexa-2,5-dieneperoxoate.
What is the SMILES notation for [dimethoxy(trimethylsilylmethyl)silyl] 2-methylhexa-2,5-dieneperoxoate?
The canonical SMILES for [dimethoxy(trimethylsilylmethyl)silyl] 2-methylhexa-2,5-dieneperoxoate is C=CCC=C(C)C(=O)OO[Si](C[Si](C)(C)C)(OC)OC.
What is the InChIKey of [dimethoxy(trimethylsilylmethyl)silyl] 2-methylhexa-2,5-dieneperoxoate?
The InChIKey is WJVZQRGDZBLBPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26O5Si2/c1-8-9-10-12(2)13(14)17-18-20(15-3,16-4)11-19(5,6)7/h8,10H,1,9,11H2,2-7H3.
What are the key properties of [dimethoxy(trimethylsilylmethyl)silyl] 2-methylhexa-2,5-dieneperoxoate?
[dimethoxy(trimethylsilylmethyl)silyl] 2-methylhexa-2,5-dieneperoxoate has a molecular weight of 318.52 g/mol, XLogP of 3.09, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [dimethoxy(trimethylsilylmethyl)silyl] 2-methylhexa-2,5-dieneperoxoate is sourced from PubChem (CID 173032273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).