C28H20Cl2F3N5O2S — CID 173032532
4-[(1,3-benzothiazol-2-ylhydrazinylidene)methyl]phenol;4-[[[2,6-dichloro-4-(trifluoromethyl)phenyl]hydrazinylidene]methyl]phenol (PubChem CID 173032532) has the molecular formula C28H20Cl2F3N5O2S and a molecular weight of 618.47 g/mol. Its IUPAC name is 4-[(1,3-benzothiazol-2-ylhydrazinylidene)methyl]phenol;4-[[[2,6-dichloro-4-(trifluoromethyl)phenyl]hydrazinylidene]methyl]phenol.
| Compound Name | 4-[(1,3-benzothiazol-2-ylhydrazinylidene)methyl]phenol;4-[[[2,6-dichloro-4-(trifluoromethyl)phenyl]hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 173032532 |
| Molecular Formula | C28H20Cl2F3N5O2S |
| Molecular Weight | 618.47 g/mol |
| Exact Mass | 617.07 |
| IUPAC Name | 4-[(1,3-benzothiazol-2-ylhydrazinylidene)methyl]phenol;4-[[[2,6-dichloro-4-(trifluoromethyl)phenyl]hydrazinylidene]methyl]phenol |
| SMILES | Oc1ccc(C=NNc2c(Cl)cc(C(F)(F)F)cc2Cl)cc1.Oc1ccc(C=NNc2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C14H9Cl2F3N2O.C14H11N3OS/c15-11-5-9(14(17,18)19)6-12(16)13(11)21-20-7-8-1-3-10(22)4-2-8;18-11-7-5-10(6-8-11)9-15-17-14-16-12-3-1-2-4-13(12)19-14/h1-7,21-22H;1-9,18H,(H,16,17) |
| InChIKey | NONVZXJEHUWYSW-UHFFFAOYSA-N |
| XLogP | 8.61 |
| TPSA | 102.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.47 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|