C20H38O3Si — CID 173033160
(7S,8S)-2-ethyl-3,7-dimethyl-8-triethylsilyloxydeca-2,5-dienoic acid (PubChem CID 173033160) has the molecular formula C20H38O3Si and a molecular weight of 354.61 g/mol. Its IUPAC name is (7S,8S)-2-ethyl-3,7-dimethyl-8-triethylsilyloxydeca-2,5-dienoic acid.
| Compound Name | (7S,8S)-2-ethyl-3,7-dimethyl-8-triethylsilyloxydeca-2,5-dienoic acid |
|---|---|
| PubChem CID | 173033160 |
| Molecular Formula | C20H38O3Si |
| Molecular Weight | 354.61 g/mol |
| Exact Mass | 354.26 |
| IUPAC Name | (7S,8S)-2-ethyl-3,7-dimethyl-8-triethylsilyloxydeca-2,5-dienoic acid |
| SMILES | CCC(C(=O)O)=C(C)CC=C[C@H](C)[C@H](CC)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C20H38O3Si/c1-8-18(20(21)22)16(6)14-13-15-17(7)19(9-2)23-24(10-3,11-4)12-5/h13,15,17,19H,8-12,14H2,1-7H3,(H,21,22)/t17-,19-/m0/s1 |
| InChIKey | YHFZWVSTFQRDOH-HKUYNNGSSA-N |
| XLogP | 6.18 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.61 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|