C10H23NSi — CID 173033827
N,2-dimethyl-N-propylsilinan-2-amine (PubChem CID 173033827) has the molecular formula C10H23NSi and a molecular weight of 185.39 g/mol. Its IUPAC name is N,2-dimethyl-N-propylsilinan-2-amine.
| Compound Name | N,2-dimethyl-N-propylsilinan-2-amine |
|---|---|
| PubChem CID | 173033827 |
| Molecular Formula | C10H23NSi |
| Molecular Weight | 185.39 g/mol |
| Exact Mass | 185.16 |
| IUPAC Name | N,2-dimethyl-N-propylsilinan-2-amine |
| SMILES | CCCN(C)C1(C)CCCC[SiH2]1 |
| InChI | InChI=1S/C10H23NSi/c1-4-8-11(3)10(2)7-5-6-9-12-10/h4-9,12H2,1-3H3 |
| InChIKey | KKYABJBIBXKTEB-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.39 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|