About N,N-dimethylmethanamine tritetrafluoroborate
N,N-dimethylmethanamine tritetrafluoroborate (PubChem CID 173034721) has the molecular formula C3H9B3F12N-3
and a molecular weight of 319.52 g/mol. Its IUPAC name is N,N-dimethylmethanamine tritetrafluoroborate.
Molecular Properties
| Compound Name | N,N-dimethylmethanamine tritetrafluoroborate |
| PubChem CID | 173034721 |
| Molecular Formula | C3H9B3F12N-3 |
| Molecular Weight | 319.52 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | N,N-dimethylmethanamine tritetrafluoroborate |
| SMILES | CN(C)C.F[B-](F)(F)F.F[B-](F)(F)F.F[B-](F)(F)F |
| InChI | InChI=1S/C3H9N.3BF4/c1-4(2)3;3*2-1(3,4)5/h1-3H3;;;/q;3*-1 |
| InChIKey | APVAJIUEPDSTMX-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.52 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethylmethanamine tritetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylmethanamine tritetrafluoroborate?
The IUPAC name of N,N-dimethylmethanamine tritetrafluoroborate (CID 173034721) is N,N-dimethylmethanamine tritetrafluoroborate.
What is the SMILES notation for N,N-dimethylmethanamine tritetrafluoroborate?
The canonical SMILES for N,N-dimethylmethanamine tritetrafluoroborate is CN(C)C.F[B-](F)(F)F.F[B-](F)(F)F.F[B-](F)(F)F.
What is the InChIKey of N,N-dimethylmethanamine tritetrafluoroborate?
The InChIKey is APVAJIUEPDSTMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9N.3BF4/c1-4(2)3;3*2-1(3,4)5/h1-3H3;;;/q;3*-1.
What are the key properties of N,N-dimethylmethanamine tritetrafluoroborate?
N,N-dimethylmethanamine tritetrafluoroborate has a molecular weight of 319.52 g/mol, XLogP of 4.08, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylmethanamine tritetrafluoroborate is sourced from PubChem (CID 173034721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).