C7H11N2NaO3 — CID 173035286
sodium;hydride;1,3,5-trimethyl-1,3-diazinane-2,4,6-trione (PubChem CID 173035286) has the molecular formula C7H11N2NaO3 and a molecular weight of 194.17 g/mol. Its IUPAC name is sodium;hydride;1,3,5-trimethyl-1,3-diazinane-2,4,6-trione.
| Compound Name | sodium;hydride;1,3,5-trimethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 173035286 |
| Molecular Formula | C7H11N2NaO3 |
| Molecular Weight | 194.17 g/mol |
| Exact Mass | 194.07 |
| IUPAC Name | sodium;hydride;1,3,5-trimethyl-1,3-diazinane-2,4,6-trione |
| SMILES | CC1C(=O)N(C)C(=O)N(C)C1=O.[H-].[Na+] |
| InChI | InChI=1S/C7H10N2O3.Na.H/c1-4-5(10)8(2)7(12)9(3)6(4)11;;/h4H,1-3H3;;/q;+1;-1 |
| InChIKey | ZWLCIISQYBTWOM-UHFFFAOYSA-N |
| XLogP | -3.21 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.17 |
| LogP ≤ 5 | -3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|