C15H14O — CID 173036066
(6Z,8E,10Z,12E)-cyclopenta[12]annulen-3a-ol (PubChem CID 173036066) has the molecular formula C15H14O and a molecular weight of 210.28 g/mol. Its IUPAC name is (6Z,8E,10Z,12E)-cyclopenta[12]annulen-3a-ol.
| Compound Name | (6Z,8E,10Z,12E)-cyclopenta[12]annulen-3a-ol |
|---|---|
| PubChem CID | 173036066 |
| Molecular Formula | C15H14O |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | (6Z,8E,10Z,12E)-cyclopenta[12]annulen-3a-ol |
| SMILES | OC12C=CC=C1/C=C/C=C\C=C\C=C/C=C2 |
| InChI | InChI=1S/C15H14O/c16-15-12-8-6-4-2-1-3-5-7-10-14(15)11-9-13-15/h1-13,16H/b2-1+,5-3-,6-4-,10-7+,12-8? |
| InChIKey | KCBVEVDOXUWBIA-CDRQVFAISA-N |
| XLogP | 3.01 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |