C17H5F11O4S2 — CID 173037321
1,2,3,4,5-pentafluoro-6-[2-[[1-fluoro-2-(2,3,4,5,6-pentafluorophenyl)ethenyl]sulfonylmethylsulfonyl]ethenyl]benzene (PubChem CID 173037321) has the molecular formula C17H5F11O4S2 and a molecular weight of 546.34 g/mol. Its IUPAC name is 1,2,3,4,5-pentafluoro-6-[2-[[1-fluoro-2-(2,3,4,5,6-pentafluorophenyl)ethenyl]sulfonylmethylsulfonyl]ethenyl]benzene.
| Compound Name | 1,2,3,4,5-pentafluoro-6-[2-[[1-fluoro-2-(2,3,4,5,6-pentafluorophenyl)ethenyl]sulfonylmethylsulfonyl]ethenyl]benzene |
|---|---|
| PubChem CID | 173037321 |
| Molecular Formula | C17H5F11O4S2 |
| Molecular Weight | 546.34 g/mol |
| Exact Mass | 545.95 |
| IUPAC Name | 1,2,3,4,5-pentafluoro-6-[2-[[1-fluoro-2-(2,3,4,5,6-pentafluorophenyl)ethenyl]sulfonylmethylsulfonyl]ethenyl]benzene |
| SMILES | O=S(=O)(C=Cc1c(F)c(F)c(F)c(F)c1F)CS(=O)(=O)C(F)=Cc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C17H5F11O4S2/c18-7(3-6-10(21)14(25)17(28)15(26)11(6)22)34(31,32)4-33(29,30)2-1-5-8(19)12(23)16(27)13(24)9(5)20/h1-3H,4H2 |
| InChIKey | MUNLVBRGWLAKDH-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.34 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|