About 7-methylnon-8-enylsilane;bis(octane)
7-methylnon-8-enylsilane;bis(octane) (PubChem CID 173037607) has the molecular formula C26H58Si
and a molecular weight of 398.84 g/mol. Its IUPAC name is 7-methylnon-8-enylsilane;bis(octane).
Molecular Properties
| Compound Name | 7-methylnon-8-enylsilane;bis(octane) |
| PubChem CID | 173037607 |
| Molecular Formula | C26H58Si |
| Molecular Weight | 398.84 g/mol |
| Exact Mass | 398.43 |
| IUPAC Name | 7-methylnon-8-enylsilane;bis(octane) |
| SMILES | C=CC(C)CCCCCC[SiH3].CCCCCCCC.CCCCCCCC |
| InChI | InChI=1S/C10H22Si.2C8H18/c1-3-10(2)8-6-4-5-7-9-11;2*1-3-5-7-8-6-4-2/h3,10H,1,4-9H2,2,11H3;2*3-8H2,1-2H3 |
| InChIKey | XNEHVWOGPOISHE-UHFFFAOYSA-N |
| XLogP | 9.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 398.84 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 7-methylnon-8-enylsilane;bis(octane) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methylnon-8-enylsilane;bis(octane)?
The IUPAC name of 7-methylnon-8-enylsilane;bis(octane) (CID 173037607) is 7-methylnon-8-enylsilane;bis(octane).
What is the SMILES notation for 7-methylnon-8-enylsilane;bis(octane)?
The canonical SMILES for 7-methylnon-8-enylsilane;bis(octane) is C=CC(C)CCCCCC[SiH3].CCCCCCCC.CCCCCCCC.
What is the InChIKey of 7-methylnon-8-enylsilane;bis(octane)?
The InChIKey is XNEHVWOGPOISHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22Si.2C8H18/c1-3-10(2)8-6-4-5-7-9-11;2*1-3-5-7-8-6-4-2/h3,10H,1,4-9H2,2,11H3;2*3-8H2,1-2H3.
What are the key properties of 7-methylnon-8-enylsilane;bis(octane)?
7-methylnon-8-enylsilane;bis(octane) has a molecular weight of 398.84 g/mol, XLogP of 9.28, 17 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methylnon-8-enylsilane;bis(octane) is sourced from PubChem (CID 173037607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).