About [4-(3,5-diphenyl-1,6-naphthyridin-2-yl)phenyl]methanamine;dihydrochloride
[4-(3,5-diphenyl-1,6-naphthyridin-2-yl)phenyl]methanamine;dihydrochloride (PubChem CID 173038029) has the molecular formula C27H23Cl2N3
and a molecular weight of 460.41 g/mol. Its IUPAC name is [4-(3,5-diphenyl-1,6-naphthyridin-2-yl)phenyl]methanamine;dihydrochloride.
Molecular Properties
| Compound Name | [4-(3,5-diphenyl-1,6-naphthyridin-2-yl)phenyl]methanamine;dihydrochloride |
| PubChem CID | 173038029 |
| Molecular Formula | C27H23Cl2N3 |
| Molecular Weight | 460.41 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | [4-(3,5-diphenyl-1,6-naphthyridin-2-yl)phenyl]methanamine;dihydrochloride |
| SMILES | Cl.Cl.NCc1ccc(-c2nc3ccnc(-c4ccccc4)c3cc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C27H21N3.2ClH/c28-18-19-11-13-22(14-12-19)27-23(20-7-3-1-4-8-20)17-24-25(30-27)15-16-29-26(24)21-9-5-2-6-10-21;;/h1-17H,18,28H2;2*1H |
| InChIKey | XKCDIUBRXNCBRC-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 460.41 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [4-(3,5-diphenyl-1,6-naphthyridin-2-yl)phenyl]methanamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(3,5-diphenyl-1,6-naphthyridin-2-yl)phenyl]methanamine;dihydrochloride?
The IUPAC name of [4-(3,5-diphenyl-1,6-naphthyridin-2-yl)phenyl]methanamine;dihydrochloride (CID 173038029) is [4-(3,5-diphenyl-1,6-naphthyridin-2-yl)phenyl]methanamine;dihydrochloride.
What is the SMILES notation for [4-(3,5-diphenyl-1,6-naphthyridin-2-yl)phenyl]methanamine;dihydrochloride?
The canonical SMILES for [4-(3,5-diphenyl-1,6-naphthyridin-2-yl)phenyl]methanamine;dihydrochloride is Cl.Cl.NCc1ccc(-c2nc3ccnc(-c4ccccc4)c3cc2-c2ccccc2)cc1.
What is the InChIKey of [4-(3,5-diphenyl-1,6-naphthyridin-2-yl)phenyl]methanamine;dihydrochloride?
The InChIKey is XKCDIUBRXNCBRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H21N3.2ClH/c28-18-19-11-13-22(14-12-19)27-23(20-7-3-1-4-8-20)17-24-25(30-27)15-16-29-26(24)21-9-5-2-6-10-21;;/h1-17H,18,28H2;2*1H.
What are the key properties of [4-(3,5-diphenyl-1,6-naphthyridin-2-yl)phenyl]methanamine;dihydrochloride?
[4-(3,5-diphenyl-1,6-naphthyridin-2-yl)phenyl]methanamine;dihydrochloride has a molecular weight of 460.41 g/mol, XLogP of 6.93, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(3,5-diphenyl-1,6-naphthyridin-2-yl)phenyl]methanamine;dihydrochloride is sourced from PubChem (CID 173038029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).