About [4-(3-phenyl-5-propyl-1,6-naphthyridin-2-yl)phenyl]methanamine;hydrochloride
[4-(3-phenyl-5-propyl-1,6-naphthyridin-2-yl)phenyl]methanamine;hydrochloride (PubChem CID 173038267) has the molecular formula C24H24ClN3
and a molecular weight of 389.93 g/mol. Its IUPAC name is [4-(3-phenyl-5-propyl-1,6-naphthyridin-2-yl)phenyl]methanamine;hydrochloride.
Molecular Properties
| Compound Name | [4-(3-phenyl-5-propyl-1,6-naphthyridin-2-yl)phenyl]methanamine;hydrochloride |
| PubChem CID | 173038267 |
| Molecular Formula | C24H24ClN3 |
| Molecular Weight | 389.93 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | [4-(3-phenyl-5-propyl-1,6-naphthyridin-2-yl)phenyl]methanamine;hydrochloride |
| SMILES | CCCc1nccc2nc(-c3ccc(CN)cc3)c(-c3ccccc3)cc12.Cl |
| InChI | InChI=1S/C24H23N3.ClH/c1-2-6-22-21-15-20(18-7-4-3-5-8-18)24(27-23(21)13-14-26-22)19-11-9-17(16-25)10-12-19;/h3-5,7-15H,2,6,16,25H2,1H3;1H |
| InChIKey | IBBWPYUWWPACJA-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 389.93 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [4-(3-phenyl-5-propyl-1,6-naphthyridin-2-yl)phenyl]methanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(3-phenyl-5-propyl-1,6-naphthyridin-2-yl)phenyl]methanamine;hydrochloride?
The IUPAC name of [4-(3-phenyl-5-propyl-1,6-naphthyridin-2-yl)phenyl]methanamine;hydrochloride (CID 173038267) is [4-(3-phenyl-5-propyl-1,6-naphthyridin-2-yl)phenyl]methanamine;hydrochloride.
What is the SMILES notation for [4-(3-phenyl-5-propyl-1,6-naphthyridin-2-yl)phenyl]methanamine;hydrochloride?
The canonical SMILES for [4-(3-phenyl-5-propyl-1,6-naphthyridin-2-yl)phenyl]methanamine;hydrochloride is CCCc1nccc2nc(-c3ccc(CN)cc3)c(-c3ccccc3)cc12.Cl.
What is the InChIKey of [4-(3-phenyl-5-propyl-1,6-naphthyridin-2-yl)phenyl]methanamine;hydrochloride?
The InChIKey is IBBWPYUWWPACJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H23N3.ClH/c1-2-6-22-21-15-20(18-7-4-3-5-8-18)24(27-23(21)13-14-26-22)19-11-9-17(16-25)10-12-19;/h3-5,7-15H,2,6,16,25H2,1H3;1H.
What are the key properties of [4-(3-phenyl-5-propyl-1,6-naphthyridin-2-yl)phenyl]methanamine;hydrochloride?
[4-(3-phenyl-5-propyl-1,6-naphthyridin-2-yl)phenyl]methanamine;hydrochloride has a molecular weight of 389.93 g/mol, XLogP of 5.80, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(3-phenyl-5-propyl-1,6-naphthyridin-2-yl)phenyl]methanamine;hydrochloride is sourced from PubChem (CID 173038267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).