About 2-methylbut-2-enoic acid;silane
2-methylbut-2-enoic acid;silane (PubChem CID 173038853) has the molecular formula C5H12O2Si
and a molecular weight of 132.23 g/mol. Its IUPAC name is 2-methylbut-2-enoic acid;silane.
Molecular Properties
| Compound Name | 2-methylbut-2-enoic acid;silane |
| PubChem CID | 173038853 |
| Molecular Formula | C5H12O2Si |
| Molecular Weight | 132.23 g/mol |
| Exact Mass | 132.06 |
| IUPAC Name | 2-methylbut-2-enoic acid;silane |
| SMILES | CC=C(C)C(=O)O.[SiH4] |
| InChI | InChI=1S/C5H8O2.H4Si/c1-3-4(2)5(6)7;/h3H,1-2H3,(H,6,7);1H4 |
| InChIKey | NJCKRHVWLFLVKT-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.23 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methylbut-2-enoic acid;silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbut-2-enoic acid;silane?
The IUPAC name of 2-methylbut-2-enoic acid;silane (CID 173038853) is 2-methylbut-2-enoic acid;silane.
What is the SMILES notation for 2-methylbut-2-enoic acid;silane?
The canonical SMILES for 2-methylbut-2-enoic acid;silane is CC=C(C)C(=O)O.[SiH4].
What is the InChIKey of 2-methylbut-2-enoic acid;silane?
The InChIKey is NJCKRHVWLFLVKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O2.H4Si/c1-3-4(2)5(6)7;/h3H,1-2H3,(H,6,7);1H4.
What are the key properties of 2-methylbut-2-enoic acid;silane?
2-methylbut-2-enoic acid;silane has a molecular weight of 132.23 g/mol, XLogP of -0.41, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbut-2-enoic acid;silane is sourced from PubChem (CID 173038853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).