C52H50S10Si — CID 173039957
dibutyl-[4-ethyl-5-(3,4,5-trithiophen-2-ylthiophen-2-yl)thiophen-3-yl]silane;2-(3-ethylthiophen-2-yl)-3,4,5-trithiophen-2-ylthiophene (PubChem CID 173039957) has the molecular formula C52H50S10Si and a molecular weight of 1023.73 g/mol. Its IUPAC name is dibutyl-[4-ethyl-5-(3,4,5-trithiophen-2-ylthiophen-2-yl)thiophen-3-yl]silane;2-(3-ethylthiophen-2-yl)-3,4,5-trithiophen-2-ylthiophene.
| Compound Name | dibutyl-[4-ethyl-5-(3,4,5-trithiophen-2-ylthiophen-2-yl)thiophen-3-yl]silane;2-(3-ethylthiophen-2-yl)-3,4,5-trithiophen-2-ylthiophene |
|---|---|
| PubChem CID | 173039957 |
| Molecular Formula | C52H50S10Si |
| Molecular Weight | 1023.73 g/mol |
| Exact Mass | 1022.09 |
| IUPAC Name | dibutyl-[4-ethyl-5-(3,4,5-trithiophen-2-ylthiophen-2-yl)thiophen-3-yl]silane;2-(3-ethylthiophen-2-yl)-3,4,5-trithiophen-2-ylthiophene |
| SMILES | CCCC[SiH](CCCC)c1csc(-c2sc(-c3cccs3)c(-c3cccs3)c2-c2cccs2)c1CC.CCc1ccsc1-c1sc(-c2cccs2)c(-c2cccs2)c1-c1cccs1 |
| InChI | InChI=1S/C30H34S5Si.C22H16S5/c1-4-7-18-36(19-8-5-2)25-20-34-28(21(25)6-3)30-27(23-13-10-16-32-23)26(22-12-9-15-31-22)29(35-30)24-14-11-17-33-24;1-2-14-9-13-26-20(14)22-19(16-7-4-11-24-16)18(15-6-3-10-23-15)21(27-22)17-8-5-12-25-17/h9-17,20,36H,4-8,18-19H2,1-3H3;3-13H,2H2,1H3 |
| InChIKey | ZCZIIMBSTWCQHE-UHFFFAOYSA-N |
| XLogP | 20.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1023.73 |
| LogP ≤ 5 | 20.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|