About 2-(2-hydroxyethyl)-1,3-dihydropyridazin-6-one
2-(2-hydroxyethyl)-1,3-dihydropyridazin-6-one (PubChem CID 173040073) has the molecular formula C6H10N2O2
and a molecular weight of 142.16 g/mol. Its IUPAC name is 2-(2-hydroxyethyl)-1,3-dihydropyridazin-6-one.
Molecular Properties
| Compound Name | 2-(2-hydroxyethyl)-1,3-dihydropyridazin-6-one |
| PubChem CID | 173040073 |
| Molecular Formula | C6H10N2O2 |
| Molecular Weight | 142.16 g/mol |
| Exact Mass | 142.07 |
| IUPAC Name | 2-(2-hydroxyethyl)-1,3-dihydropyridazin-6-one |
| SMILES | O=C1C=CCN(CCO)N1 |
| InChI | InChI=1S/C6H10N2O2/c9-5-4-8-3-1-2-6(10)7-8/h1-2,9H,3-5H2,(H,7,10) |
| InChIKey | DVAQGHZLJZOKKG-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.16 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2-hydroxyethyl)-1,3-dihydropyridazin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-hydroxyethyl)-1,3-dihydropyridazin-6-one?
The IUPAC name of 2-(2-hydroxyethyl)-1,3-dihydropyridazin-6-one (CID 173040073) is 2-(2-hydroxyethyl)-1,3-dihydropyridazin-6-one.
What is the SMILES notation for 2-(2-hydroxyethyl)-1,3-dihydropyridazin-6-one?
The canonical SMILES for 2-(2-hydroxyethyl)-1,3-dihydropyridazin-6-one is O=C1C=CCN(CCO)N1.
What is the InChIKey of 2-(2-hydroxyethyl)-1,3-dihydropyridazin-6-one?
The InChIKey is DVAQGHZLJZOKKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2O2/c9-5-4-8-3-1-2-6(10)7-8/h1-2,9H,3-5H2,(H,7,10).
What are the key properties of 2-(2-hydroxyethyl)-1,3-dihydropyridazin-6-one?
2-(2-hydroxyethyl)-1,3-dihydropyridazin-6-one has a molecular weight of 142.16 g/mol, XLogP of -1.12, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-hydroxyethyl)-1,3-dihydropyridazin-6-one is sourced from PubChem (CID 173040073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).