About 2-ethoxyimino-4,4,4-trifluoro-3-oxobutanoic acid
2-ethoxyimino-4,4,4-trifluoro-3-oxobutanoic acid (PubChem CID 173040474) has the molecular formula C6H6F3NO4
and a molecular weight of 213.11 g/mol. Its IUPAC name is 2-ethoxyimino-4,4,4-trifluoro-3-oxobutanoic acid.
Molecular Properties
| Compound Name | 2-ethoxyimino-4,4,4-trifluoro-3-oxobutanoic acid |
| PubChem CID | 173040474 |
| Molecular Formula | C6H6F3NO4 |
| Molecular Weight | 213.11 g/mol |
| Exact Mass | 213.02 |
| IUPAC Name | 2-ethoxyimino-4,4,4-trifluoro-3-oxobutanoic acid |
| SMILES | CCON=C(C(=O)O)C(=O)C(F)(F)F |
| InChI | InChI=1S/C6H6F3NO4/c1-2-14-10-3(5(12)13)4(11)6(7,8)9/h2H2,1H3,(H,12,13) |
| InChIKey | ONQYFFZAONDYPV-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.11 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-ethoxyimino-4,4,4-trifluoro-3-oxobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxyimino-4,4,4-trifluoro-3-oxobutanoic acid?
The IUPAC name of 2-ethoxyimino-4,4,4-trifluoro-3-oxobutanoic acid (CID 173040474) is 2-ethoxyimino-4,4,4-trifluoro-3-oxobutanoic acid.
What is the SMILES notation for 2-ethoxyimino-4,4,4-trifluoro-3-oxobutanoic acid?
The canonical SMILES for 2-ethoxyimino-4,4,4-trifluoro-3-oxobutanoic acid is CCON=C(C(=O)O)C(=O)C(F)(F)F.
What is the InChIKey of 2-ethoxyimino-4,4,4-trifluoro-3-oxobutanoic acid?
The InChIKey is ONQYFFZAONDYPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6F3NO4/c1-2-14-10-3(5(12)13)4(11)6(7,8)9/h2H2,1H3,(H,12,13).
What are the key properties of 2-ethoxyimino-4,4,4-trifluoro-3-oxobutanoic acid?
2-ethoxyimino-4,4,4-trifluoro-3-oxobutanoic acid has a molecular weight of 213.11 g/mol, XLogP of 0.59, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxyimino-4,4,4-trifluoro-3-oxobutanoic acid is sourced from PubChem (CID 173040474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).