About N-[5-[(5,5-dimethyl-4H-1,2-oxazol-3-yl)sulfonyl]-4-methylpent-3-en-2-ylidene]hydroxylamine
N-[5-[(5,5-dimethyl-4H-1,2-oxazol-3-yl)sulfonyl]-4-methylpent-3-en-2-ylidene]hydroxylamine (PubChem CID 173040717) has the molecular formula C11H18N2O4S
and a molecular weight of 274.34 g/mol. Its IUPAC name is N-[5-[(5,5-dimethyl-4H-1,2-oxazol-3-yl)sulfonyl]-4-methylpent-3-en-2-ylidene]hydroxylamine.
Molecular Properties
| Compound Name | N-[5-[(5,5-dimethyl-4H-1,2-oxazol-3-yl)sulfonyl]-4-methylpent-3-en-2-ylidene]hydroxylamine |
| PubChem CID | 173040717 |
| Molecular Formula | C11H18N2O4S |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | N-[5-[(5,5-dimethyl-4H-1,2-oxazol-3-yl)sulfonyl]-4-methylpent-3-en-2-ylidene]hydroxylamine |
| SMILES | CC(=CC(C)=NO)CS(=O)(=O)C1=NOC(C)(C)C1 |
| InChI | InChI=1S/C11H18N2O4S/c1-8(5-9(2)12-14)7-18(15,16)10-6-11(3,4)17-13-10/h5,14H,6-7H2,1-4H3 |
| InChIKey | ZXUKUQQJNRXCMY-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[5-[(5,5-dimethyl-4H-1,2-oxazol-3-yl)sulfonyl]-4-methylpent-3-en-2-ylidene]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-[(5,5-dimethyl-4H-1,2-oxazol-3-yl)sulfonyl]-4-methylpent-3-en-2-ylidene]hydroxylamine?
The IUPAC name of N-[5-[(5,5-dimethyl-4H-1,2-oxazol-3-yl)sulfonyl]-4-methylpent-3-en-2-ylidene]hydroxylamine (CID 173040717) is N-[5-[(5,5-dimethyl-4H-1,2-oxazol-3-yl)sulfonyl]-4-methylpent-3-en-2-ylidene]hydroxylamine.
What is the SMILES notation for N-[5-[(5,5-dimethyl-4H-1,2-oxazol-3-yl)sulfonyl]-4-methylpent-3-en-2-ylidene]hydroxylamine?
The canonical SMILES for N-[5-[(5,5-dimethyl-4H-1,2-oxazol-3-yl)sulfonyl]-4-methylpent-3-en-2-ylidene]hydroxylamine is CC(=CC(C)=NO)CS(=O)(=O)C1=NOC(C)(C)C1.
What is the InChIKey of N-[5-[(5,5-dimethyl-4H-1,2-oxazol-3-yl)sulfonyl]-4-methylpent-3-en-2-ylidene]hydroxylamine?
The InChIKey is ZXUKUQQJNRXCMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O4S/c1-8(5-9(2)12-14)7-18(15,16)10-6-11(3,4)17-13-10/h5,14H,6-7H2,1-4H3.
What are the key properties of N-[5-[(5,5-dimethyl-4H-1,2-oxazol-3-yl)sulfonyl]-4-methylpent-3-en-2-ylidene]hydroxylamine?
N-[5-[(5,5-dimethyl-4H-1,2-oxazol-3-yl)sulfonyl]-4-methylpent-3-en-2-ylidene]hydroxylamine has a molecular weight of 274.34 g/mol, XLogP of 1.71, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-[(5,5-dimethyl-4H-1,2-oxazol-3-yl)sulfonyl]-4-methylpent-3-en-2-ylidene]hydroxylamine is sourced from PubChem (CID 173040717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).