C34H43ClN2O — CID 173040793
6-[10-[(E,3E)-3-(3,3-dimethyl-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-ylidene)prop-1-enyl]-9-methyl-1-azatricyclo[6.3.1.04,12]dodeca-4(12),5,7,10-tetraen-9-yl]hexan-1-ol;hydrochloride (PubChem CID 173040793) has the molecular formula C34H43ClN2O and a molecular weight of 531.18 g/mol. Its IUPAC name is 6-[10-[(E,3E)-3-(3,3-dimethyl-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-ylidene)prop-1-enyl]-9-methyl-1-azatricyclo[6.3.1.04,12]dodeca-4(12),5,7,10-tetraen-9-yl]hexan-1-ol;hydrochloride.
| Compound Name | 6-[10-[(E,3E)-3-(3,3-dimethyl-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-ylidene)prop-1-enyl]-9-methyl-1-azatricyclo[6.3.1.04,12]dodeca-4(12),5,7,10-tetraen-9-yl]hexan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 173040793 |
| Molecular Formula | C34H43ClN2O |
| Molecular Weight | 531.18 g/mol |
| Exact Mass | 530.31 |
| IUPAC Name | 6-[10-[(E,3E)-3-(3,3-dimethyl-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-ylidene)prop-1-enyl]-9-methyl-1-azatricyclo[6.3.1.04,12]dodeca-4(12),5,7,10-tetraen-9-yl]hexan-1-ol;hydrochloride |
| SMILES | CC1(CCCCCCO)C(/C=C/C=C2/N3CCCc4cccc(c43)C2(C)C)=CN2CCc3cccc1c32.Cl |
| InChI | InChI=1S/C34H42N2O.ClH/c1-33(2)28-16-8-12-25-14-11-21-36(32(25)28)30(33)18-10-15-27-24-35-22-19-26-13-9-17-29(31(26)35)34(27,3)20-6-4-5-7-23-37;/h8-10,12-13,15-18,24,37H,4-7,11,14,19-23H2,1-3H3;1H/b15-10+,30-18+; |
| InChIKey | XMCDZCNEGLMRTQ-DQQTWGPUSA-N |
| XLogP | 7.75 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.18 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|