C20H23F3N6O5S — CID 173040847
2,2,2-trifluoro-N-[N-hydroxy-C-[3-methyl-4-[5-[(4-methylsulfonylphenyl)methoxy]pyrimidin-2-yl]piperazin-1-yl]carbonimidoyl]acetamide (PubChem CID 173040847) has the molecular formula C20H23F3N6O5S and a molecular weight of 516.50 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[N-hydroxy-C-[3-methyl-4-[5-[(4-methylsulfonylphenyl)methoxy]pyrimidin-2-yl]piperazin-1-yl]carbonimidoyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[N-hydroxy-C-[3-methyl-4-[5-[(4-methylsulfonylphenyl)methoxy]pyrimidin-2-yl]piperazin-1-yl]carbonimidoyl]acetamide |
|---|---|
| PubChem CID | 173040847 |
| Molecular Formula | C20H23F3N6O5S |
| Molecular Weight | 516.50 g/mol |
| Exact Mass | 516.14 |
| IUPAC Name | 2,2,2-trifluoro-N-[N-hydroxy-C-[3-methyl-4-[5-[(4-methylsulfonylphenyl)methoxy]pyrimidin-2-yl]piperazin-1-yl]carbonimidoyl]acetamide |
| SMILES | CC1CN(C(=NO)NC(=O)C(F)(F)F)CCN1c1ncc(OCc2ccc(S(C)(=O)=O)cc2)cn1 |
| InChI | InChI=1S/C20H23F3N6O5S/c1-13-11-28(19(27-31)26-17(30)20(21,22)23)7-8-29(13)18-24-9-15(10-25-18)34-12-14-3-5-16(6-4-14)35(2,32)33/h3-6,9-10,13,31H,7-8,11-12H2,1-2H3,(H,26,27,30) |
| InChIKey | VREKNQFJNZJMTJ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 137.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.50 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|