About 4-(3-chlorophenyl)-2-hydroxy-2-(4-nitrophenoxy)-1,3,2-dioxaphosphinan-2-ium
4-(3-chlorophenyl)-2-hydroxy-2-(4-nitrophenoxy)-1,3,2-dioxaphosphinan-2-ium (PubChem CID 173041106) has the molecular formula C15H14ClNO6P+
and a molecular weight of 370.71 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-2-hydroxy-2-(4-nitrophenoxy)-1,3,2-dioxaphosphinan-2-ium.
Molecular Properties
| Compound Name | 4-(3-chlorophenyl)-2-hydroxy-2-(4-nitrophenoxy)-1,3,2-dioxaphosphinan-2-ium |
| PubChem CID | 173041106 |
| Molecular Formula | C15H14ClNO6P+ |
| Molecular Weight | 370.71 g/mol |
| Exact Mass | 370.02 |
| IUPAC Name | 4-(3-chlorophenyl)-2-hydroxy-2-(4-nitrophenoxy)-1,3,2-dioxaphosphinan-2-ium |
| SMILES | O=[N+]([O-])c1ccc(O[P+]2(O)OCCC(c3cccc(Cl)c3)O2)cc1 |
| InChI | InChI=1S/C15H14ClNO6P/c16-12-3-1-2-11(10-12)15-8-9-21-24(20,23-15)22-14-6-4-13(5-7-14)17(18)19/h1-7,10,15,20H,8-9H2/q+1 |
| InChIKey | HCFURGRDQVCZRG-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.71 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4-(3-chlorophenyl)-2-hydroxy-2-(4-nitrophenoxy)-1,3,2-dioxaphosphinan-2-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-chlorophenyl)-2-hydroxy-2-(4-nitrophenoxy)-1,3,2-dioxaphosphinan-2-ium?
The IUPAC name of 4-(3-chlorophenyl)-2-hydroxy-2-(4-nitrophenoxy)-1,3,2-dioxaphosphinan-2-ium (CID 173041106) is 4-(3-chlorophenyl)-2-hydroxy-2-(4-nitrophenoxy)-1,3,2-dioxaphosphinan-2-ium.
What is the SMILES notation for 4-(3-chlorophenyl)-2-hydroxy-2-(4-nitrophenoxy)-1,3,2-dioxaphosphinan-2-ium?
The canonical SMILES for 4-(3-chlorophenyl)-2-hydroxy-2-(4-nitrophenoxy)-1,3,2-dioxaphosphinan-2-ium is O=[N+]([O-])c1ccc(O[P+]2(O)OCCC(c3cccc(Cl)c3)O2)cc1.
What is the InChIKey of 4-(3-chlorophenyl)-2-hydroxy-2-(4-nitrophenoxy)-1,3,2-dioxaphosphinan-2-ium?
The InChIKey is HCFURGRDQVCZRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14ClNO6P/c16-12-3-1-2-11(10-12)15-8-9-21-24(20,23-15)22-14-6-4-13(5-7-14)17(18)19/h1-7,10,15,20H,8-9H2/q+1.
What are the key properties of 4-(3-chlorophenyl)-2-hydroxy-2-(4-nitrophenoxy)-1,3,2-dioxaphosphinan-2-ium?
4-(3-chlorophenyl)-2-hydroxy-2-(4-nitrophenoxy)-1,3,2-dioxaphosphinan-2-ium has a molecular weight of 370.71 g/mol, XLogP of 4.48, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-chlorophenyl)-2-hydroxy-2-(4-nitrophenoxy)-1,3,2-dioxaphosphinan-2-ium is sourced from PubChem (CID 173041106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).