About sodium;2-chloro-2,2-difluoroacetic acid;hydride
sodium;2-chloro-2,2-difluoroacetic acid;hydride (PubChem CID 173041563) has the molecular formula C2H2ClF2NaO2
and a molecular weight of 154.47 g/mol. Its IUPAC name is sodium;2-chloro-2,2-difluoroacetic acid;hydride.
Molecular Properties
| Compound Name | sodium;2-chloro-2,2-difluoroacetic acid;hydride |
| PubChem CID | 173041563 |
| Molecular Formula | C2H2ClF2NaO2 |
| Molecular Weight | 154.47 g/mol |
| Exact Mass | 153.96 |
| IUPAC Name | sodium;2-chloro-2,2-difluoroacetic acid;hydride |
| SMILES | O=C(O)C(F)(F)Cl.[H-].[Na+] |
| InChI | InChI=1S/C2HClF2O2.Na.H/c3-2(4,5)1(6)7;;/h(H,6,7);;/q;+1;-1 |
| InChIKey | ATNMBELVPYIIOV-UHFFFAOYSA-N |
| XLogP | -1.98 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.47 |
| LogP ≤ 5 | -1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze sodium;2-chloro-2,2-difluoroacetic acid;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;2-chloro-2,2-difluoroacetic acid;hydride?
The IUPAC name of sodium;2-chloro-2,2-difluoroacetic acid;hydride (CID 173041563) is sodium;2-chloro-2,2-difluoroacetic acid;hydride.
What is the SMILES notation for sodium;2-chloro-2,2-difluoroacetic acid;hydride?
The canonical SMILES for sodium;2-chloro-2,2-difluoroacetic acid;hydride is O=C(O)C(F)(F)Cl.[H-].[Na+].
What is the InChIKey of sodium;2-chloro-2,2-difluoroacetic acid;hydride?
The InChIKey is ATNMBELVPYIIOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C2HClF2O2.Na.H/c3-2(4,5)1(6)7;;/h(H,6,7);;/q;+1;-1.
What are the key properties of sodium;2-chloro-2,2-difluoroacetic acid;hydride?
sodium;2-chloro-2,2-difluoroacetic acid;hydride has a molecular weight of 154.47 g/mol, XLogP of -1.98, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;2-chloro-2,2-difluoroacetic acid;hydride is sourced from PubChem (CID 173041563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).