About lead(2+) dihydride diazide
lead(2+) dihydride diazide (PubChem CID 173041928) has the molecular formula N6Pb
and a molecular weight of 291.24 g/mol. Its IUPAC name is lead(2+) dihydride diazide.
Molecular Properties
| Compound Name | lead(2+) dihydride diazide |
| PubChem CID | 173041928 |
| Molecular Formula | N6Pb |
| Molecular Weight | 291.24 g/mol |
| Exact Mass | 292.00 |
| IUPAC Name | lead(2+) dihydride diazide |
| SMILES | [N-]=[N+]=[N-].[N-]=[N+]=[N-].[Pb+2] |
| InChI | InChI=1S/2N3.Pb/c2*1-3-2;/q2*-1;+2 |
| InChIKey | ISEQAARZRCDNJH-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 117.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.24 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze lead(2+) dihydride diazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lead(2+) dihydride diazide?
The IUPAC name of lead(2+) dihydride diazide (CID 173041928) is lead(2+) dihydride diazide.
What is the SMILES notation for lead(2+) dihydride diazide?
The canonical SMILES for lead(2+) dihydride diazide is [N-]=[N+]=[N-].[N-]=[N+]=[N-].[Pb+2].
What is the InChIKey of lead(2+) dihydride diazide?
The InChIKey is ISEQAARZRCDNJH-UHFFFAOYSA-N. The full InChI is InChI=1S/2N3.Pb/c2*1-3-2;/q2*-1;+2.
What are the key properties of lead(2+) dihydride diazide?
lead(2+) dihydride diazide has a molecular weight of 291.24 g/mol, XLogP of 1.35, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for lead(2+) dihydride diazide is sourced from PubChem (CID 173041928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).