About difluoro(penta-1,4-dienyl)silane
difluoro(penta-1,4-dienyl)silane (PubChem CID 173042117) has the molecular formula C5H8F2Si
and a molecular weight of 134.20 g/mol. Its IUPAC name is difluoro(penta-1,4-dienyl)silane.
Molecular Properties
| Compound Name | difluoro(penta-1,4-dienyl)silane |
| PubChem CID | 173042117 |
| Molecular Formula | C5H8F2Si |
| Molecular Weight | 134.20 g/mol |
| Exact Mass | 134.04 |
| IUPAC Name | difluoro(penta-1,4-dienyl)silane |
| SMILES | C=CCC=C[SiH](F)F |
| InChI | InChI=1S/C5H8F2Si/c1-2-3-4-5-8(6)7/h2,4-5,8H,1,3H2 |
| InChIKey | AVNULDCYQKNTLK-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.20 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze difluoro(penta-1,4-dienyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of difluoro(penta-1,4-dienyl)silane?
The IUPAC name of difluoro(penta-1,4-dienyl)silane (CID 173042117) is difluoro(penta-1,4-dienyl)silane.
What is the SMILES notation for difluoro(penta-1,4-dienyl)silane?
The canonical SMILES for difluoro(penta-1,4-dienyl)silane is C=CCC=C[SiH](F)F.
What is the InChIKey of difluoro(penta-1,4-dienyl)silane?
The InChIKey is AVNULDCYQKNTLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8F2Si/c1-2-3-4-5-8(6)7/h2,4-5,8H,1,3H2.
What are the key properties of difluoro(penta-1,4-dienyl)silane?
difluoro(penta-1,4-dienyl)silane has a molecular weight of 134.20 g/mol, XLogP of 1.82, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for difluoro(penta-1,4-dienyl)silane is sourced from PubChem (CID 173042117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).