C25H27N7O3 — CID 173042203
2-[4-amino-3-(5-hydroxy-1H-indol-2-yl)pyrazolo[3,4-d]pyrimidin-1-yl]-1-piperidin-1-ylhept-5-ene-1,4-dione (PubChem CID 173042203) has the molecular formula C25H27N7O3 and a molecular weight of 473.54 g/mol. Its IUPAC name is 2-[4-amino-3-(5-hydroxy-1H-indol-2-yl)pyrazolo[3,4-d]pyrimidin-1-yl]-1-piperidin-1-ylhept-5-ene-1,4-dione.
| Compound Name | 2-[4-amino-3-(5-hydroxy-1H-indol-2-yl)pyrazolo[3,4-d]pyrimidin-1-yl]-1-piperidin-1-ylhept-5-ene-1,4-dione |
|---|---|
| PubChem CID | 173042203 |
| Molecular Formula | C25H27N7O3 |
| Molecular Weight | 473.54 g/mol |
| Exact Mass | 473.22 |
| IUPAC Name | 2-[4-amino-3-(5-hydroxy-1H-indol-2-yl)pyrazolo[3,4-d]pyrimidin-1-yl]-1-piperidin-1-ylhept-5-ene-1,4-dione |
| SMILES | CC=CC(=O)CC(C(=O)N1CCCCC1)n1nc(-c2cc3cc(O)ccc3[nH]2)c2c(N)ncnc21 |
| InChI | InChI=1S/C25H27N7O3/c1-2-6-16(33)13-20(25(35)31-9-4-3-5-10-31)32-24-21(23(26)27-14-28-24)22(30-32)19-12-15-11-17(34)7-8-18(15)29-19/h2,6-8,11-12,14,20,29,34H,3-5,9-10,13H2,1H3,(H2,26,27,28) |
| InChIKey | ZOALUSMHUDEDCM-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 143.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.54 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|