C28H38F3N6O5+ — CID 173042356
[5-[5-(1-acetylpiperidine-4-carbonyl)-2,5-diazabicyclo[2.2.2]octan-2-yl]-1-(2,2-dimethylpropyl)-3-methyl-2-oxoimidazo[4,5-b]pyridin-1-ium-1-yl] 2,2,2-trifluoroacetate (PubChem CID 173042356) has the molecular formula C28H38F3N6O5+ and a molecular weight of 595.64 g/mol. Its IUPAC name is [5-[5-(1-acetylpiperidine-4-carbonyl)-2,5-diazabicyclo[2.2.2]octan-2-yl]-1-(2,2-dimethylpropyl)-3-methyl-2-oxoimidazo[4,5-b]pyridin-1-ium-1-yl] 2,2,2-trifluoroacetate.
| Compound Name | [5-[5-(1-acetylpiperidine-4-carbonyl)-2,5-diazabicyclo[2.2.2]octan-2-yl]-1-(2,2-dimethylpropyl)-3-methyl-2-oxoimidazo[4,5-b]pyridin-1-ium-1-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 173042356 |
| Molecular Formula | C28H38F3N6O5+ |
| Molecular Weight | 595.64 g/mol |
| Exact Mass | 595.29 |
| IUPAC Name | [5-[5-(1-acetylpiperidine-4-carbonyl)-2,5-diazabicyclo[2.2.2]octan-2-yl]-1-(2,2-dimethylpropyl)-3-methyl-2-oxoimidazo[4,5-b]pyridin-1-ium-1-yl] 2,2,2-trifluoroacetate |
| SMILES | CC(=O)N1CCC(C(=O)N2CC3CCC2CN3c2ccc3c(n2)N(C)C(=O)[N+]3(CC(C)(C)C)OC(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C28H38F3N6O5/c1-17(38)34-12-10-18(11-13-34)24(39)36-15-19-6-7-20(36)14-35(19)22-9-8-21-23(32-22)33(5)26(41)37(21,16-27(2,3)4)42-25(40)28(29,30)31/h8-9,18-20H,6-7,10-16H2,1-5H3/q+1 |
| InChIKey | RDHHNPSEDFWXKB-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 103.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.64 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|