C23H18N4O4S — CID 173042977
1-(benzylideneamino)-3-(1,1-dihydroxy-4H-1λ4,2,4-benzothiadiazin-3-yl)-4-hydroxyquinolin-2-one (PubChem CID 173042977) has the molecular formula C23H18N4O4S and a molecular weight of 446.49 g/mol. Its IUPAC name is 1-(benzylideneamino)-3-(1,1-dihydroxy-4H-1λ4,2,4-benzothiadiazin-3-yl)-4-hydroxyquinolin-2-one.
| Compound Name | 1-(benzylideneamino)-3-(1,1-dihydroxy-4H-1λ4,2,4-benzothiadiazin-3-yl)-4-hydroxyquinolin-2-one |
|---|---|
| PubChem CID | 173042977 |
| Molecular Formula | C23H18N4O4S |
| Molecular Weight | 446.49 g/mol |
| Exact Mass | 446.10 |
| IUPAC Name | 1-(benzylideneamino)-3-(1,1-dihydroxy-4H-1λ4,2,4-benzothiadiazin-3-yl)-4-hydroxyquinolin-2-one |
| SMILES | O=c1c(C2=NS(O)(O)c3ccccc3N2)c(O)c2ccccc2n1N=Cc1ccccc1 |
| InChI | InChI=1S/C23H18N4O4S/c28-21-16-10-4-6-12-18(16)27(24-14-15-8-2-1-3-9-15)23(29)20(21)22-25-17-11-5-7-13-19(17)32(30,31)26-22/h1-14,28,30-31H,(H,25,26) |
| InChIKey | JCTCUVVCSHFSLR-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 119.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.49 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|