C22H38 — CID 173043089
3-(2,2-dimethylpropyl)-3-[1-(2,2-dimethylpropyl)cyclohex-3-en-1-yl]cyclohexene (PubChem CID 173043089) has the molecular formula C22H38 and a molecular weight of 302.55 g/mol. Its IUPAC name is 3-(2,2-dimethylpropyl)-3-[1-(2,2-dimethylpropyl)cyclohex-3-en-1-yl]cyclohexene.
| Compound Name | 3-(2,2-dimethylpropyl)-3-[1-(2,2-dimethylpropyl)cyclohex-3-en-1-yl]cyclohexene |
|---|---|
| PubChem CID | 173043089 |
| Molecular Formula | C22H38 |
| Molecular Weight | 302.55 g/mol |
| Exact Mass | 302.30 |
| IUPAC Name | 3-(2,2-dimethylpropyl)-3-[1-(2,2-dimethylpropyl)cyclohex-3-en-1-yl]cyclohexene |
| SMILES | CC(C)(C)CC1(C2(CC(C)(C)C)CC=CCC2)C=CCCC1 |
| InChI | InChI=1S/C22H38/c1-19(2,3)17-21(13-9-7-10-14-21)22(18-20(4,5)6)15-11-8-12-16-22/h7,9,11,15H,8,10,12-14,16-18H2,1-6H3 |
| InChIKey | QMDQRDPZEAPNHD-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.55 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|