About O-[2-[3-(4-bromophenyl)-3-hydroxyprop-2-enoyl]-4-methylphenyl] carbamothioate;O-methyl carbamothioate
O-[2-[3-(4-bromophenyl)-3-hydroxyprop-2-enoyl]-4-methylphenyl] carbamothioate;O-methyl carbamothioate (PubChem CID 173043191) has the molecular formula C19H19BrN2O4S2
and a molecular weight of 483.41 g/mol. Its IUPAC name is O-[2-[3-(4-bromophenyl)-3-hydroxyprop-2-enoyl]-4-methylphenyl] carbamothioate;O-methyl carbamothioate.
Molecular Properties
| Compound Name | O-[2-[3-(4-bromophenyl)-3-hydroxyprop-2-enoyl]-4-methylphenyl] carbamothioate;O-methyl carbamothioate |
| PubChem CID | 173043191 |
| Molecular Formula | C19H19BrN2O4S2 |
| Molecular Weight | 483.41 g/mol |
| Exact Mass | 482.00 |
| IUPAC Name | O-[2-[3-(4-bromophenyl)-3-hydroxyprop-2-enoyl]-4-methylphenyl] carbamothioate;O-methyl carbamothioate |
| SMILES | COC(N)=S.Cc1ccc(OC(N)=S)c(C(=O)C=C(O)c2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C17H14BrNO3S.C2H5NOS/c1-10-2-7-16(22-17(19)23)13(8-10)15(21)9-14(20)11-3-5-12(18)6-4-11;1-4-2(3)5/h2-9,20H,1H3,(H2,19,23);1H3,(H2,3,5) |
| InChIKey | CLDJHXGSIKVGGY-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 107.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 483.41 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-[2-[3-(4-bromophenyl)-3-hydroxyprop-2-enoyl]-4-methylphenyl] carbamothioate;O-methyl carbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-[2-[3-(4-bromophenyl)-3-hydroxyprop-2-enoyl]-4-methylphenyl] carbamothioate;O-methyl carbamothioate?
The IUPAC name of O-[2-[3-(4-bromophenyl)-3-hydroxyprop-2-enoyl]-4-methylphenyl] carbamothioate;O-methyl carbamothioate (CID 173043191) is O-[2-[3-(4-bromophenyl)-3-hydroxyprop-2-enoyl]-4-methylphenyl] carbamothioate;O-methyl carbamothioate.
What is the SMILES notation for O-[2-[3-(4-bromophenyl)-3-hydroxyprop-2-enoyl]-4-methylphenyl] carbamothioate;O-methyl carbamothioate?
The canonical SMILES for O-[2-[3-(4-bromophenyl)-3-hydroxyprop-2-enoyl]-4-methylphenyl] carbamothioate;O-methyl carbamothioate is COC(N)=S.Cc1ccc(OC(N)=S)c(C(=O)C=C(O)c2ccc(Br)cc2)c1.
What is the InChIKey of O-[2-[3-(4-bromophenyl)-3-hydroxyprop-2-enoyl]-4-methylphenyl] carbamothioate;O-methyl carbamothioate?
The InChIKey is CLDJHXGSIKVGGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14BrNO3S.C2H5NOS/c1-10-2-7-16(22-17(19)23)13(8-10)15(21)9-14(20)11-3-5-12(18)6-4-11;1-4-2(3)5/h2-9,20H,1H3,(H2,19,23);1H3,(H2,3,5).
What are the key properties of O-[2-[3-(4-bromophenyl)-3-hydroxyprop-2-enoyl]-4-methylphenyl] carbamothioate;O-methyl carbamothioate?
O-[2-[3-(4-bromophenyl)-3-hydroxyprop-2-enoyl]-4-methylphenyl] carbamothioate;O-methyl carbamothioate has a molecular weight of 483.41 g/mol, XLogP of 4.04, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for O-[2-[3-(4-bromophenyl)-3-hydroxyprop-2-enoyl]-4-methylphenyl] carbamothioate;O-methyl carbamothioate is sourced from PubChem (CID 173043191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).