About CID 173044329
CID 173044329 (PubChem CID 173044329) has the molecular formula C9H15Si
and a molecular weight of 151.30 g/mol.
Molecular Properties
| Compound Name | CID 173044329 |
| PubChem CID | 173044329 |
| Molecular Formula | C9H15Si |
| Molecular Weight | 151.30 g/mol |
| Exact Mass | 151.09 |
| IUPAC Name | — |
| SMILES | C/C=C\[Si](/C=C\C)/C=C\C |
| InChI | InChI=1S/C9H15Si/c1-4-7-10(8-5-2)9-6-3/h4-9H,1-3H3/b7-4-,8-5-,9-6- |
| InChIKey | XPCPJDAKQCBNTB-PXLQOLDUSA-N |
| XLogP | 2.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.30 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 173044329 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 173044329?
The IUPAC name of CID 173044329 (CID 173044329) is not available.
What is the SMILES notation for CID 173044329?
The canonical SMILES for CID 173044329 is C/C=C\[Si](/C=C\C)/C=C\C.
What is the InChIKey of CID 173044329?
The InChIKey is XPCPJDAKQCBNTB-PXLQOLDUSA-N. The full InChI is InChI=1S/C9H15Si/c1-4-7-10(8-5-2)9-6-3/h4-9H,1-3H3/b7-4-,8-5-,9-6-.
What are the key properties of CID 173044329?
CID 173044329 has a molecular weight of 151.30 g/mol, XLogP of 2.83, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 173044329 is sourced from PubChem (CID 173044329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).