C24H21NNa2O7S2 — CID 173044520
disodium;4-[2-[4-[7-(methoxymethyl)-2,3-dihydro-1H-isoindol-1-yl]phenyl]ethenyl]benzene-1,3-disulfonate (PubChem CID 173044520) has the molecular formula C24H21NNa2O7S2 and a molecular weight of 545.55 g/mol. Its IUPAC name is disodium;4-[2-[4-[7-(methoxymethyl)-2,3-dihydro-1H-isoindol-1-yl]phenyl]ethenyl]benzene-1,3-disulfonate.
| Compound Name | disodium;4-[2-[4-[7-(methoxymethyl)-2,3-dihydro-1H-isoindol-1-yl]phenyl]ethenyl]benzene-1,3-disulfonate |
|---|---|
| PubChem CID | 173044520 |
| Molecular Formula | C24H21NNa2O7S2 |
| Molecular Weight | 545.55 g/mol |
| Exact Mass | 545.06 |
| IUPAC Name | disodium;4-[2-[4-[7-(methoxymethyl)-2,3-dihydro-1H-isoindol-1-yl]phenyl]ethenyl]benzene-1,3-disulfonate |
| SMILES | COCc1cccc2c1C(c1ccc(C=Cc3ccc(S(=O)(=O)[O-])cc3S(=O)(=O)[O-])cc1)NC2.[Na+].[Na+] |
| InChI | InChI=1S/C24H23NO7S2.2Na/c1-32-15-20-4-2-3-19-14-25-24(23(19)20)18-9-6-16(7-10-18)5-8-17-11-12-21(33(26,27)28)13-22(17)34(29,30)31;;/h2-13,24-25H,14-15H2,1H3,(H,26,27,28)(H,29,30,31);;/q;2*+1/p-2 |
| InChIKey | SOWRKHIOYSTHGC-UHFFFAOYSA-L |
| XLogP | -2.99 |
| TPSA | 135.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.55 |
| LogP ≤ 5 | -2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|