About N-(2-amino-1,3-thiazol-4-yl)-N-[2-[3-(1-methylpyrazol-4-yl)phenoxy]ethyl]acetamide
N-(2-amino-1,3-thiazol-4-yl)-N-[2-[3-(1-methylpyrazol-4-yl)phenoxy]ethyl]acetamide (PubChem CID 173044826) has the molecular formula C17H19N5O2S
and a molecular weight of 357.44 g/mol. Its IUPAC name is N-(2-amino-1,3-thiazol-4-yl)-N-[2-[3-(1-methylpyrazol-4-yl)phenoxy]ethyl]acetamide.
Molecular Properties
| Compound Name | N-(2-amino-1,3-thiazol-4-yl)-N-[2-[3-(1-methylpyrazol-4-yl)phenoxy]ethyl]acetamide |
| PubChem CID | 173044826 |
| Molecular Formula | C17H19N5O2S |
| Molecular Weight | 357.44 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | N-(2-amino-1,3-thiazol-4-yl)-N-[2-[3-(1-methylpyrazol-4-yl)phenoxy]ethyl]acetamide |
| SMILES | CC(=O)N(CCOc1cccc(-c2cnn(C)c2)c1)c1csc(N)n1 |
| InChI | InChI=1S/C17H19N5O2S/c1-12(23)22(16-11-25-17(18)20-16)6-7-24-15-5-3-4-13(8-15)14-9-19-21(2)10-14/h3-5,8-11H,6-7H2,1-2H3,(H2,18,20) |
| InChIKey | YTBBTPPHEPZAOM-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.44 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-(2-amino-1,3-thiazol-4-yl)-N-[2-[3-(1-methylpyrazol-4-yl)phenoxy]ethyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-amino-1,3-thiazol-4-yl)-N-[2-[3-(1-methylpyrazol-4-yl)phenoxy]ethyl]acetamide?
The IUPAC name of N-(2-amino-1,3-thiazol-4-yl)-N-[2-[3-(1-methylpyrazol-4-yl)phenoxy]ethyl]acetamide (CID 173044826) is N-(2-amino-1,3-thiazol-4-yl)-N-[2-[3-(1-methylpyrazol-4-yl)phenoxy]ethyl]acetamide.
What is the SMILES notation for N-(2-amino-1,3-thiazol-4-yl)-N-[2-[3-(1-methylpyrazol-4-yl)phenoxy]ethyl]acetamide?
The canonical SMILES for N-(2-amino-1,3-thiazol-4-yl)-N-[2-[3-(1-methylpyrazol-4-yl)phenoxy]ethyl]acetamide is CC(=O)N(CCOc1cccc(-c2cnn(C)c2)c1)c1csc(N)n1.
What is the InChIKey of N-(2-amino-1,3-thiazol-4-yl)-N-[2-[3-(1-methylpyrazol-4-yl)phenoxy]ethyl]acetamide?
The InChIKey is YTBBTPPHEPZAOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N5O2S/c1-12(23)22(16-11-25-17(18)20-16)6-7-24-15-5-3-4-13(8-15)14-9-19-21(2)10-14/h3-5,8-11H,6-7H2,1-2H3,(H2,18,20).
What are the key properties of N-(2-amino-1,3-thiazol-4-yl)-N-[2-[3-(1-methylpyrazol-4-yl)phenoxy]ethyl]acetamide?
N-(2-amino-1,3-thiazol-4-yl)-N-[2-[3-(1-methylpyrazol-4-yl)phenoxy]ethyl]acetamide has a molecular weight of 357.44 g/mol, XLogP of 2.56, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-amino-1,3-thiazol-4-yl)-N-[2-[3-(1-methylpyrazol-4-yl)phenoxy]ethyl]acetamide is sourced from PubChem (CID 173044826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).