About 6-chloro-2,3,4,4a-tetrahydroquinolin-1-ium
6-chloro-2,3,4,4a-tetrahydroquinolin-1-ium (PubChem CID 173044930) has the molecular formula C9H11ClN+
and a molecular weight of 168.65 g/mol. Its IUPAC name is 6-chloro-2,3,4,4a-tetrahydroquinolin-1-ium.
Molecular Properties
| Compound Name | 6-chloro-2,3,4,4a-tetrahydroquinolin-1-ium |
| PubChem CID | 173044930 |
| Molecular Formula | C9H11ClN+ |
| Molecular Weight | 168.65 g/mol |
| Exact Mass | 168.06 |
| IUPAC Name | 6-chloro-2,3,4,4a-tetrahydroquinolin-1-ium |
| SMILES | ClC1=CC2CCC[NH+]=C2C=C1 |
| InChI | InChI=1S/C9H10ClN/c10-8-3-4-9-7(6-8)2-1-5-11-9/h3-4,6-7H,1-2,5H2/p+1 |
| InChIKey | SVYWFJTYPMWEJI-UHFFFAOYSA-O |
| XLogP | 0.61 |
| TPSA | 13.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.65 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 6-chloro-2,3,4,4a-tetrahydroquinolin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-2,3,4,4a-tetrahydroquinolin-1-ium?
The IUPAC name of 6-chloro-2,3,4,4a-tetrahydroquinolin-1-ium (CID 173044930) is 6-chloro-2,3,4,4a-tetrahydroquinolin-1-ium.
What is the SMILES notation for 6-chloro-2,3,4,4a-tetrahydroquinolin-1-ium?
The canonical SMILES for 6-chloro-2,3,4,4a-tetrahydroquinolin-1-ium is ClC1=CC2CCC[NH+]=C2C=C1.
What is the InChIKey of 6-chloro-2,3,4,4a-tetrahydroquinolin-1-ium?
The InChIKey is SVYWFJTYPMWEJI-UHFFFAOYSA-O. The full InChI is InChI=1S/C9H10ClN/c10-8-3-4-9-7(6-8)2-1-5-11-9/h3-4,6-7H,1-2,5H2/p+1.
What are the key properties of 6-chloro-2,3,4,4a-tetrahydroquinolin-1-ium?
6-chloro-2,3,4,4a-tetrahydroquinolin-1-ium has a molecular weight of 168.65 g/mol, XLogP of 0.61, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-2,3,4,4a-tetrahydroquinolin-1-ium is sourced from PubChem (CID 173044930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).