About 9-pent-1-enylanthracene
9-pent-1-enylanthracene (PubChem CID 173045692) has the molecular formula C19H18
and a molecular weight of 246.35 g/mol. Its IUPAC name is 9-pent-1-enylanthracene.
Molecular Properties
| Compound Name | 9-pent-1-enylanthracene |
| PubChem CID | 173045692 |
| Molecular Formula | C19H18 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 9-pent-1-enylanthracene |
| SMILES | CCCC=Cc1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C19H18/c1-2-3-4-13-19-17-11-7-5-9-15(17)14-16-10-6-8-12-18(16)19/h4-14H,2-3H2,1H3 |
| InChIKey | VGSFGUWYHRPBQE-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 9-pent-1-enylanthracene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-pent-1-enylanthracene?
The IUPAC name of 9-pent-1-enylanthracene (CID 173045692) is 9-pent-1-enylanthracene.
What is the SMILES notation for 9-pent-1-enylanthracene?
The canonical SMILES for 9-pent-1-enylanthracene is CCCC=Cc1c2ccccc2cc2ccccc12.
What is the InChIKey of 9-pent-1-enylanthracene?
The InChIKey is VGSFGUWYHRPBQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18/c1-2-3-4-13-19-17-11-7-5-9-15(17)14-16-10-6-8-12-18(16)19/h4-14H,2-3H2,1H3.
What are the key properties of 9-pent-1-enylanthracene?
9-pent-1-enylanthracene has a molecular weight of 246.35 g/mol, XLogP of 5.81, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 9-pent-1-enylanthracene is sourced from PubChem (CID 173045692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).