About 2-but-2-ynyl-1,3,4,5-tetramethylbenzene
2-but-2-ynyl-1,3,4,5-tetramethylbenzene (PubChem CID 173045835) has the molecular formula C14H18
and a molecular weight of 186.30 g/mol. Its IUPAC name is 2-but-2-ynyl-1,3,4,5-tetramethylbenzene.
Molecular Properties
| Compound Name | 2-but-2-ynyl-1,3,4,5-tetramethylbenzene |
| PubChem CID | 173045835 |
| Molecular Formula | C14H18 |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | 2-but-2-ynyl-1,3,4,5-tetramethylbenzene |
| SMILES | CC#CCc1c(C)cc(C)c(C)c1C |
| InChI | InChI=1S/C14H18/c1-6-7-8-14-11(3)9-10(2)12(4)13(14)5/h9H,8H2,1-5H3 |
| InChIKey | VDXJWISKQDIRKS-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-but-2-ynyl-1,3,4,5-tetramethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-but-2-ynyl-1,3,4,5-tetramethylbenzene?
The IUPAC name of 2-but-2-ynyl-1,3,4,5-tetramethylbenzene (CID 173045835) is 2-but-2-ynyl-1,3,4,5-tetramethylbenzene.
What is the SMILES notation for 2-but-2-ynyl-1,3,4,5-tetramethylbenzene?
The canonical SMILES for 2-but-2-ynyl-1,3,4,5-tetramethylbenzene is CC#CCc1c(C)cc(C)c(C)c1C.
What is the InChIKey of 2-but-2-ynyl-1,3,4,5-tetramethylbenzene?
The InChIKey is VDXJWISKQDIRKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18/c1-6-7-8-14-11(3)9-10(2)12(4)13(14)5/h9H,8H2,1-5H3.
What are the key properties of 2-but-2-ynyl-1,3,4,5-tetramethylbenzene?
2-but-2-ynyl-1,3,4,5-tetramethylbenzene has a molecular weight of 186.30 g/mol, XLogP of 3.49, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-but-2-ynyl-1,3,4,5-tetramethylbenzene is sourced from PubChem (CID 173045835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).