C26H33FN2O — CID 173046527
N'-(4-fluorophenyl)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenehydrazide (PubChem CID 173046527) has the molecular formula C26H33FN2O and a molecular weight of 408.56 g/mol. Its IUPAC name is N'-(4-fluorophenyl)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenehydrazide.
| Compound Name | N'-(4-fluorophenyl)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenehydrazide |
|---|---|
| PubChem CID | 173046527 |
| Molecular Formula | C26H33FN2O |
| Molecular Weight | 408.56 g/mol |
| Exact Mass | 408.26 |
| IUPAC Name | N'-(4-fluorophenyl)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenehydrazide |
| SMILES | CC(C=CC1=C(C)CCCC1(C)C)=CC=CC(C)=CC(=O)NNc1ccc(F)cc1 |
| InChI | InChI=1S/C26H33FN2O/c1-19(11-16-24-21(3)10-7-17-26(24,4)5)8-6-9-20(2)18-25(30)29-28-23-14-12-22(27)13-15-23/h6,8-9,11-16,18,28H,7,10,17H2,1-5H3,(H,29,30) |
| InChIKey | KFRQYYUHJFZUBI-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.56 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|